Daurisoline

Catalog Number	ACM70553763
CAS Number	70553-76-3
Synonyms	(R,R)-Daurisoline
IUPAC Name	(1R)-1-[[3-[4-[[(1R)-6,7-Dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]methyl]phenoxy]-4-hydroxyphenyl]methyl]-6-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-7-ol
Molecular Weight	610.74
Molecular Formula	C37H42N2O6
Canonical SMILES	CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)OC4=C(C=CC(=C4)CC5C6=CC(=C(C=C6CCN5C)OC)O)O)OC)OC
InChI	InChI=1S/C37H42N2O6/c1-38-15-13-26-20-36(43-4)37(44-5)22-29(26)30(38)16-23-6-9-27(10-7-23)45-35-18-24(8-11-32(35)40)17-31-28-21-33(41)34(42-3)19-25(28)12-14-39(31)2/h6-11,18-22,30-31,40-41H,12-17H2,1-5H3/t30-,31-/m1/s1
InChI Key	BURJAQFYNVMZDV-FIRIVFDPSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	917
Exact Mass	610.30428706
Heavy Atom Count	45
Isomeric SMILES	CN1CCC2=CC(=C(C=C2[C@H]1CC3=CC=C(C=C3)OC4=C(C=CC(=C4)C[C@@H]5C6=CC(=C(C=C6CCN5C)OC)O)O)OC)OC
Monoisotopic Mass	610.30428706
Topological Polar Surface Area	83.9Ų

Custom Q&A

What is daurisoline's boiling point?

Daurisoline's boiling point is predicted to be 724.5±60.0 °C.

How is daurisoline stored?

Daurisoline is stored at -20°C and protected from light.

What is the color of daurisoline?

Daurisoline is a white to beige powder.

What is the molecular formula of daurisoline?

The molecular formula of daurisoline is C37H42N2O6.

Where is daurisoline sourced from?

Daurisoline is extracted from the rhizomes of Menispermum dauricum DC.

What is the pharmacological activity of daurisoline?

Daurisoline is a strong Ca ion antagonist with potential antihypertensive and antiarrhythmic activity.

What is the chemical analysis method used for daurisoline?

Daurisoline is characterized by high-performance liquid chromatography with acetonitrile-water-triethylamine as the mobile phase.

What is the safety information for daurisoline?

Daurisoline has safety statements 24/25 and is classified as WGK Germany 3.

How is daurisoline metabolized in the body?

Pharmacokinetic studies have shown that daurisoline follows a two-compartment open model with rapid dispersion, faster elimination, and extensive distribution.

How is daurisoline separated from other compounds during extraction?

Daurisoline is separated by dissolving the phenolic alkaloids in chloroform, extracting with sodium hydroxide, and adjusting the pH to precipitate the daurisoline.

※ Please kindly note that our products are for research use only.