Delsoline

Catalog Number	ACM509182
CAS Number	509-18-2
Synonyms	14-O-Methyldelcosine
IUPAC Name	(1S,2R,3R,4S,5R,6S,8R,9S,13S,16S,17R,18S)-11-ethyl-4,6,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-8,9,16-triol
Molecular Weight	467.6
Molecular Formula	C25H41NO7
Canonical SMILES	CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@@H]([C@@](C31)([C@]5(C[C@@H]([C@H]6C[C@@H]4[C@@H]5[C@H]6OC)OC)O)O)OC)O)COC
InChI	InChI=1S/C25H41NO7/c1-6-26-11-22(12-30-2)8-7-16(27)24-14-9-13-15(31-3)10-23(28,17(14)18(13)32-4)25(29,21(24)26)20(33-5)19(22)24/h13-21,27-29H,6-12H2,1-5H3/t13-,14-,15+,16+,17-,18+,19-,20+,21?,22+,23-,24+,25-/m1/s1
InChI Key	JVBLTQQBEQQLEV-YAEAOFIFSA-N
Boiling Point	576.0±50.0 °C
Melting Point	214 °C
Purity	98%
Density	1.31±0.1 g/ml
Appearance	Powder
Complexity	814
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	12
Exact Mass	467.28830265
Heavy Atom Count	33
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	3
Isomeric SMILES	CCN1C[C@@]2(CC[C@@H]([C@@]34[C@@H]2[C@@H]([C@@](C31)([C@]5(C[C@@H]([C@H]6C[C@@H]4[C@@H]5[C@H]6OC)OC)O)O)OC)O)COC
Monoisotopic Mass	467.28830265
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	101 Ų

Custom Q&A

What are the synonyms for ACOMONINE?

Delsoline
2. What is the molecular formula of ACOMONINE?
C25H41NO7
3. What is the molecular weight of ACOMONINE?
467.6
4. At what temperature does ACOMONINE melt?
208-210°C
5. How should ACOMONINE be stored?
At 2-8°C
6. What is the chemical property of ACOMONINE in terms of its form?
Solid
7. In which plant does delsoline occur?
Delphinium ajacis or Consolida ambigua
8. What is the structure of acomonine?
The structure given above, with the position of the fourth methoxyl group still being in doubt
9. How is the anhydro derivative of acomonine formed?
The p?toluensulphonyl chloride readily forms the anhydro derivative when heated
10. What is the usage of delsoline?
Delsoline is a hypotensive alkaloid isolated from Aconitum plant

※ Please kindly note that our products are for research use only.