Denudatine

Catalog Number	ACM26166370
CAS Number	26166-37-0
Structure
Description	Denudatine is an alkaloid found in the plant families, Aconitum and Veratrum. It is a diterpenoid alkaloid with a structural skeleton that contains an asymmetric carbon atom. Denudatine can be synthesized by reacting acetylacetone with acetic acid and hydrogen chloride gas in a reaction solution. The nmr spectra of denudatine show signals at δ 5.6 (1H), 3.2 (3H), 1.32 (3H) and 1.06 ppm (3H). The chemical reactions of denudatine involve the formation of fatty acids, which are used to produce various substances such as carotenoids, steroids, and vitamin D2. Denudatine has been shown to have receptor binding activity, similar to that of aconitine alkaloids from the genus Aconitum or c19-diterpenoid alkaloids from the genus Ver
Molecular Weight	343.5 g/mol
Molecular Formula	C22H33NO2
Canonical SMILES	CCN1C[C@@]2(CCC[C@@]34[C@@H]2C[C@@H](C31)[C@]56[C@H]4[C@H]([C@H](CC5)C(=C)[C@H]6O)O)C
Storage	store at 2℃-8℃
MDL Number	MFCD00221741

Custom Q&A

What is the molecular formula of Denudatine?

The molecular formula of Denudatine is C22H33NO2.

What is the molecular weight of Denudatine?

The molecular weight of Denudatine is 343.5.

What are the main product categories that Denudatine falls under?

Denudatine falls under the category of Miscellaneous Natural Products.

Where is Denudatine obtained from?

Denudatine is obtained from the leaves of some Mongolian Ranunculaceae species.

What activity does Denudatine display?

Denudatine displays anti-fungal activity.

What type of compound is Denudatine?

Denudatine is an alkaloid.

How is Denudatine commonly used in medical or research applications?

Denudatine is commonly used for its anti-fungal properties in medical or research applications.

※ Please kindly note that our products are for research use only.