Deoxyisocalyciphylline B

Catalog Number	ACM619326759
CAS Number	619326-75-9
Molecular Weight	341.5
InChI	InChI=1S/C22H31NO2/c1-13-12-23-19-16-5-3-4-14(16)6-7-17(19)21(2)22(11-9-18(24)25-21)10-8-15(13)20(22)23/h5,13-15,17,19-20H,3-4,6-12H2,1-2H3/t13-,14-,15-,17+,19+,20+,21+,22+/m1/s1
InChI Key	NGQSEZXJVMCXSC-BPGMYFSDSA-N
Purity	95%+
Complexity	671
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	8
Exact Mass	341.235479232
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@@H]1CN2[C@@H]3[C@H](CC[C@@H]4C3=CCC4)[C@]5([C@]6([C@@H]2[C@@H]1CC6)CCC(=O)O5)C
Monoisotopic Mass	341.235479232
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	29.5 Ų

Custom Q&A

What is the product name of the compound that is also known as Deoxyisocalyciphylline B?

The product name is Deoxyisocalyciphylline B.

What are some synonyms for Deoxyisocalyciphylline B?

Some synonyms include (1S,6S,7S,10R,15R,18S,19R,22S)-6,18-dimethyl-5-oxa-16-azahexacyclo[14.5.1.0^{1,6}.0^{7,15}.0^{10,14}.0^{19,22}]docos-13-en-4-one.

What is the CAS number for Deoxyisocalyciphylline B?

The CAS number is 619326-75-9.

What is the chemical formula for Deoxyisocalyciphylline B?

The chemical formula is C22H31NO2.

What is the structure of Deoxyisocalyciphylline B?

The compound has a 6,18-dimethyl-5-oxa-16-azahexacyclo[14.5.1.0^{1,6}.0^{7,15}.0^{10,14}.0^{19,22}]docos-13-en-4-one structure.

What is the molecular formula for Deoxyisocalyciphylline B?

The molecular formula is C22H31NO2.

What is the stereochemistry of Deoxyisocalyciphylline B?

The compound has the stereochemistry of (1S,6S,7S,10R,15R,18S,19R,22S).

※ Please kindly note that our products are for research use only.