1-Deoxynojirimycin

Catalog Number	ACM19130962-3
CAS Number	19130-96-2
Structure
Synonyms	Moranoline
IUPAC Name	(2R,3R,4R,5S)-2-(Hydroxymethyl)piperidine-3,4,5-triol
Molecular Weight	163.17
Molecular Formula	C6H13NO4
Canonical SMILES	C1C(C(C(C(N1)CO)O)O)O
InChI	InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4+,5-,6-/m1/s1
InChI Key	LXBIFEVIBLOUGU-JGWLITMVSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	132
Exact Mass	163.08445790
Heavy Atom Count	11
Isomeric SMILES	C1[C@@H]([C@H]([C@@H]([C@H](N1)CO)O)O)O
Monoisotopic Mass	163.08445790
Topological Polar Surface Area	93Ų

Custom Q&A

What is the chemical name of 1-Deoxynojirimycin?

The chemical name of 1-Deoxynojirimycin is (2R,3R,4R,5S)-2-Hydroxymethyl-piperidine-3,4,5-triol.

What is the synonym for 1-Deoxynojirimycin?

The synonym for 1-Deoxynojirimycin includes Moranoline, Moranolin, and Bay-h5595.

What is the molecular formula of 1-Deoxynojirimycin?

The molecular formula of 1-Deoxynojirimycin is C6H13NO4.

Mention one of the product categories that 1-Deoxynojirimycin belongs to.

1-Deoxynojirimycin belongs to the product category of pharmaceutical intermediate.

What is the boiling point of 1-Deoxynojirimycin?

The predicted boiling point of 1-Deoxynojirimycin is 361.1±42.0 °C.

What is the storage temperature recommended for 1-Deoxynojirimycin?

1-Deoxynojirimycin should be stored in a dark place, under an inert atmosphere, and in a freezer, under -20°C.

What is the use of 1-Deoxynojirimycin in biological activity?

1-Deoxynojirimycin inhibits glucosidase I and II, with Ki values of 2.1mM and 7mM, respectively.

What is a potential application of 1-Deoxynojirimycin in relation to human immunodeficiency virus?

1-Deoxynojirimycin can block human immunodeficiency virus envelope glycoprotein-mediated membrane fusion at the CXCR4 binding step.

How does 1-Deoxynojirimycin affect the absorption of sugar in the human body?

1-Deoxynojirimycin inhibits sucrose, maltase, α-glucosidase enzyme, and α-amylase, thereby blocking sugar absorption in the human body.

What is one of the safety statements associated with 1-Deoxynojirimycin?

One of the safety statements for 1-Deoxynojirimycin is 24/25.

※ Please kindly note that our products are for research use only.