Dicentrine

Catalog Number	ACM517668
CAS Number	517-66-8
Synonyms	1,2-Methylenedioxy-9,10-dimethoxyaporphine
IUPAC Name	9,10-Dimethoxy-1,2-(methylenedioxy)aporphine
Molecular Weight	339.4
Molecular Formula	C20H21NO4
Canonical SMILES	CN1CCC2=CC3=C(C4=C2C1CC5=CC(=C(C=C54)OC)OC)OCO3
InChI	InChI=1S/C20H21NO4/c1-21-5-4-11-7-17-20(25-10-24-17)19-13-9-16(23-3)15(22-2)8-12(13)6-14(21)18(11)19/h7-9,14H,4-6,10H2,1-3H3/t14-/m0/s1
InChI Key	YJWBWQWUHVXPNC-AWEZNQCLSA-N
Boiling Point	480.7ºC at 760mmHg
Melting Point	177-178 °C
Flash Point	142.7ºC
Purity	95%+
Density	1.266g/cm³
Complexity	502
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	339.14705815
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC(=C(C=C54)OC)OC)OCO3
Monoisotopic Mass	339.14705815
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	40.2 Ų

Custom Q&A

What is the chemical name of the compound Dicentrin?

The chemical name of the compound Dicentrin is (7aS)-6,7,7a,8-Tetrahydro-10,11-dimethoxy-7-methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline.

What is the molecular formula of Dicentrin?

The molecular formula of Dicentrin is C20H21NO4.

What is the molecular weight of Dicentrin?

The molecular weight of Dicentrin is 339.39.

At what temperature does Dicentrin melt?

Dicentrin melts at 177-178℃.

What is one of the known uses of Dicentrin?

One of the known uses of Dicentrin is its potential anti-cancer activity.

In what plant species is Dicentrin found?

Dicentrin is found in several plant species, mainly from the family Lauraceae, including Lindera megaphylla.

How does Dicentrin show antinociceptive activity?

Dicentrin shows antinociceptive activity in a mouse model of pain probably via a TRPA1-dependent mechanism.

What is the storage temperature recommended for Dicentrin?

The recommended storage temperature for Dicentrin is 4°C, and it should be protected from light.

How does Dicentrin inhibit the growth of human hepatoma cell lines?

Dicentrin inhibits the growth of human hepatoma cell lines by delaying their doubling time in tissue culture and decreasing colony formation efficiency.

What type of alkaloid is Dicentrin classified as?

Dicentrin is classified as an aporphine alkaloid.

※ Please kindly note that our products are for research use only.