Dichotomine B

Catalog Number	ACM755036410
CAS Number	755036-41-0
Molecular Weight	272.26
InChI	InChI=1S/C14H12N2O4/c17-6-11(18)13-12-8(5-10(16-13)14(19)20)7-3-1-2-4-9(7)15-12/h1-5,11,15,17-18H,6H2,(H,19,20)/t11-/m0/s1
InChI Key	PKSXEHHRROSXPR-NSHDSACASA-N
Purity	95%+
Complexity	378
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	272.07970687
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	4
Isomeric SMILES	C1=CC=C2C(=C1)C3=CC(=NC(=C3N2)C(CO)O)C(=O)O
Monoisotopic Mass	272.07970687
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	106 Ų

Custom Q&A

What is the chemical name of Dichotomine B?

The chemical name of Dichotomine B is 9H-Pyrido[3,4-b]indole-3-carboxylic acid, 1-[(1R)-1,2-dihydroxyethyl]-.

What is the CAS number of Dichotomine B?

The CAS number of Dichotomine B is 755036-41-0.

What is the molecular formula of Dichotomine B?

The molecular formula of Dichotomine B is C14H12N2O4.

What is the molar mass of Dichotomine B?

The molar mass of Dichotomine B is 272.26 g/mol.

What is the boiling point of Dichotomine B?

The boiling point of Dichotomine B is predicted to be 671.4±55.0 °C.

What is the density of Dichotomine B?

The density of Dichotomine B is predicted to be 1.598±0.06 g/cm3.

What is the pka value of Dichotomine B?

The pka value of Dichotomine B is predicted to be 1.38±0.30.

How is Dichotomine B predicted to behave at its boiling point?

Dichotomine B is predicted to have a boiling point of 671.4±55.0 °C.

How is Dichotomine B predicted to behave in terms of density?

Dichotomine B is predicted to have a density of 1.598±0.06 g/cm3.

What is the predicted pka value of Dichotomine B?

The predicted pka value of Dichotomine B is 1.38±0.30.

※ Please kindly note that our products are for research use only.