Dictamnine

Catalog Number	ACM484297
CAS Number	484-29-7
Structure
Synonyms	4-Methoxyfuro[2,3-b]quinoline
Molecular Weight	199.2
InChI	InChI=1S/C12H9NO2/c1-14-11-8-4-2-3-5-10(8)13-12-9(11)6-7-15-12/h2-7H,1H3
InChI Key	WIONIXOBNMDJFJ-UHFFFAOYSA-N
Melting Point	133 °C
Purity	98%+
Complexity	234
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	199.06332853
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	199.06332853
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	35.3 Ų

Custom Q&A

What is the chemical formula of Dictamnine?

The chemical formula of Dictamnine is C12H9NO2.

What is the molecular weight of Dictamnine?

The molecular weight of Dictamnine is 199.21.

What are some synonyms for Dictamnine?

Some synonyms for Dictamnine include Dictamine, Dectamine, and 4-Methoxyfuro[2,3-b]quinoline.

What are the product categories that Dictamnine falls under?

Dictamnine falls under categories such as miscellaneous natural products, chemical reagents, pharmaceutical intermediates, and standardized herbal extracts.

What is the melting point of Dictamnine?

The melting point of Dictamnine is 133°C.

What are some of the chemical properties of Dictamnine?

Some chemical properties of Dictamnine include its light beige color, its solubility in chloroform and methanol, and its refractive index of 1.5880.

What are the uses of Dictamnine?

Dictamnine is used as an antifungal, vasal relaxant, smooth muscle contractant, and as an herbal extract with anti-microbial activity against bacteria and fungi.

Where is Dictamnine extracted from?

Dictamnine is an herbal extract from the root of Dictamnus dasycarpus.

What is the synthesis reference for Dictamnine?

The synthesis reference for Dictamnine is Tetrahedron Letters, 14, p. 843, 1973.

What is the pka of Dictamnine?

The pka of Dictamnine is 7.24±0.40 (predicted).

※ Please kindly note that our products are for research use only.