Dihydrocinchonamine

Catalog Number	ACM10283688-1
CAS Number	10283-68-8
Structure
Synonyms	2-[(1S,4S)-5β-Ethyl-1-azabicyclo[2.2.2]octan-2α-yl]-1H-indole-3-ethanol
Molecular Weight	298.4
InChI	InChI=1S/C19H26N2O/c1-2-13-12-21-9-7-14(13)11-18(21)19-16(8-10-22)15-5-3-4-6-17(15)20-19/h3-6,13-14,18,20,22H,2,7-12H2,1H3/t13-,14-,18-/m0/s1
InChI Key	TVGAQUQPXOADEM-DEYYWGMASA-N
Purity	95%+
Complexity	388
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	298.204513457
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC[C@H]1CN2CC[C@H]1C[C@H]2C3=C(C4=CC=CC=C4N3)CCO
Monoisotopic Mass	298.204513457
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	39.3 Ų

Custom Q&A

What is the chemical name of dihydrocinchonamine?

The chemical name of dihydrocinchonamine is 2-[(1S,4S)-5β-Ethyl-1-azabicyclo[2.2.2]octa-2α-yl]-1H-indole-3-ethanol.

What are the synonyms for dihydrocinchonamine?

The synonyms for dihydrocinchonamine include 2-[(1S,4S)-5β-Ethyl-1-azabicyclo[2.2.2]octan-2α-yl]-1H-indole-3-ethanol, and 2-[2-(5-ethyl-1-aza-bicyclo[2.2.2]oct-2-yl)-indol-3-yl]-ethanol.

What is the CAS number for dihydrocinchonamine?

The CAS number for dihydrocinchonamine is 10283-68-8.

What is the molecular formula of dihydrocinchonamine?

The molecular formula of dihydrocinchonamine is C19H26N2O.

What is the molecular weight of dihydrocinchonamine?

The molecular weight of dihydrocinchonamine is 298.42 g/mol.

What is the melting point of dihydrocinchonamine?

The melting point of dihydrocinchonamine is 161-162 °C when dissolved in methanol.

What is the boiling point of dihydrocinchonamine?

The boiling point of dihydrocinchonamine is predicted to be 480.4±35.0 °C.

What is the density of dihydrocinchonamine?

The density of dihydrocinchonamine is predicted to be 1.18±0.1 g/cm3.

What is the pka value of dihydrocinchonamine?

The pka value of dihydrocinchonamine is predicted to be 14.94±0.10.

How does the chemical structure of dihydrocinchonamine contribute to its properties?

The chemical structure of dihydrocinchonamine, with its unique arrangement of atoms, influences its melting point, boiling point, density, and other chemical properties.

※ Please kindly note that our products are for research use only.