Dihydrocorynantheine

Catalog Number	ACM4684439
CAS Number	4684-43-9
Synonyms	(AlphaE,2R,3S,12bR)-rel-3-ethyl-1,2,3,4,6,7,12,12b-octahydro-alpha-(methoxymethylene)-indolo[2,3-a]quinolizine-2-acetic acid methyl ester
Molecular Weight	368.5
InChI	InChI=1S/C22H28N2O3/c1-4-14-12-24-10-9-16-15-7-5-6-8-19(15)23-21(16)20(24)11-17(14)18(13-26-2)22(25)27-3/h5-8,13-14,17,20,23H,4,9-12H2,1-3H3/b18-13+/t14-,17,20/m0/s1
InChI Key	NMLUOJBSAYAYEM-WODWAOHHSA-N
Purity	95%+
Complexity	578
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	368.20999276
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC[C@H]1CN2CCC3=C(C2CC1/C(=C\OC)/C(=O)OC)NC4=CC=CC=C34
Monoisotopic Mass	368.20999276
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	54.6 Ų

Custom Q&A

What is the molecular formula of Dihydrocorynantheine?

The molecular formula of Dihydrocorynantheine is C22H28N2O3.

What is the CAS number for Dihydrocorynantheine?

The CAS number for Dihydrocorynantheine is 50439-68-4.

What is the chemical structure of Dihydrocorynantheine?

The chemical structure is given by (16E)-16,17-Didehydro-17-methoxycorynan-16-carboxylic acid methyl ester.

What is the melting point of Dihydrocorynantheine?

The melting point of Dihydrocorynantheine is 103-104 °C.

What is the boiling point of Dihydrocorynantheine?

The boiling point of Dihydrocorynantheine is 531.7±50.0 °C.

What is the predicted density of Dihydrocorynantheine?

The predicted density of Dihydrocorynantheine is 1.20±0.1 g/cm3.

What is the pka value of Dihydrocorynantheine?

The pka value of Dihydrocorynantheine is 18.13±0.60.

What is the role of Dihydrocorynantheine?

Dihydrocorynantheine is an alkaloid with a role as a metabolite.

How is Dihydrocorynantheine used in synthesis?

Dihydrocorynantheine is used in the synthesis of various compounds due to its chemical properties.

What is the molecular weight of Dihydrocorynantheine?

The molecular weight of Dihydrocorynantheine is 368.48.

※ Please kindly note that our products are for research use only.