Dihydroepistephamiersine 6-acetate

Catalog Number	ACM57361747
CAS Number	57361-74-7
Synonyms	Hasubanan-6-ol, 8,10-epoxy-3,4,7,8-tetramethoxy-17-methyl-, acetate (ester), (6β,7β,8β,10β)- (9CI)
Molecular Weight	433.5
InChI	InChI=1S/C23H31NO7/c1-13(25)30-17-11-21-9-10-24(2)22(21)12-16(31-23(22,29-6)20(17)28-5)14-7-8-15(26-3)19(27-4)18(14)21/h7-8,16-17,20H,9-12H2,1-6H3/t16?,17?,20?,21-,22-,23-/m0/s1
InChI Key	SCWUZSBREAMJGL-XLSOAHDVSA-N
Purity	95%+
Complexity	735
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	433.21005233
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC(=O)OC1C[C@]23CCN([C@@]24CC(C5=C3C(=C(C=C5)OC)OC)O[C@]4(C1OC)OC)C
Monoisotopic Mass	433.21005233
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	75.7 Ų

Custom Q&A

What is the chemical formula for Dihydroepistephamiersine 6-acetate?

The chemical formula for Dihydroepistephamiersine 6-acetate is C23H31NO7.

What is the molecular weight of Dihydroepistephamiersine 6-acetate?

The molecular weight of Dihydroepistephamiersine 6-acetate is 433.5.

What is the CAS number for Dihydroepistephamiersine 6-acetate?

The CAS number for Dihydroepistephamiersine 6-acetate is 57361-74-7.

What is the predicted boiling point of Dihydroepistephamiersine 6-acetate?

The predicted boiling point of Dihydroepistephamiersine 6-acetate is 539.6±50.0 °C.

In which solvents is Dihydroepistephamiersine 6-acetate soluble?

Dihydroepistephamiersine 6-acetate is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted density of Dihydroepistephamiersine 6-acetate?

The predicted density of Dihydroepistephamiersine 6-acetate is 1.29±0.1 g/cm3.

In what form does Dihydroepistephamiersine 6-acetate exist?

Dihydroepistephamiersine 6-acetate exists in the form of a powder.

What is the predicted pka value of Dihydroepistephamiersine 6-acetate?

The predicted pka value of Dihydroepistephamiersine 6-acetate is 6.46±0.70.

What are some of the synonyms for Dihydroepistephamiersine 6-acetate?

Some synonyms for Dihydroepistephamiersine 6-acetate include DIHYDROEPISTEPHAMIERSINE 6-ACETA and Hasubanan-6-ol, 8,10-epoxy-3,4,7,8-tetramethoxy-17-methyl-, acetate (ester), (6β,7β,8β,10β).

How is Dihydroepistephamiersine 6-acetate commonly referred to?

Dihydroepistephamiersine 6-acetate is commonly referred to as 6-Dihydroepistephamiersine-6-acetate.

※ Please kindly note that our products are for research use only.