Dihydroergocryptine

Catalog Number	ACM25447669
CAS Number	25447-66-9
Structure
Description	Dihydroergocryptine is a metabolite of ergotamine. It is used as an analytical reference material for the identification of ergot alkaloids in HPLC standards. Dihydroergocryptine is also used as a reference material in the screening and quality control of herbal products, such as phytochemicals or bioactive compounds.
Molecular Weight	577.7 g/mol
Molecular Formula	C32H43N5O5
Canonical SMILES	CC(C)CC1C(=O)N2CCCC2C3(N1C(=O)C(O3)(C(C)C)NC(=O)C4CC5C(CC6=CNC7=CC=CC5=C67)N(C4)C)O

Custom Q&A

What is another name for Dihydro α-Ergocryptine?

Dihydroergocryptine

What is the chemical formula of Dihydro α-Ergocryptine?

C32H43N5O5

At what temperature does Dihydro α-Ergocryptine decompose?

235 °C

What is the solubility of Dihydro α-Ergocryptine in DMSO, Methanol, and Pyridine?

Slightly soluble in DMSO, Methanol, and Pyridine

What is the stability of Dihydro α-Ergocryptine?

Hygroscopic

What is the melting point of Dihydro α-Ergocryptine?

235 °C

What is the primary usage of Dihydro α-Ergocryptine?

Treatment of impaired mental function in the elderly

What is the specific mixture of compounds in Dihydro α-Ergocryptine?

Dihydroergocornine methanesulfonate, dihydroergocristine methanesulfonate, α and β-dihydroergocrytine methanesulfonate

What type of alkaloids are present in Dihydro α-Ergocryptine?

Hydrogenated ergot alkaloids

What is the boiling point of Dihydro α-Ergocryptine?

848.7±65.0 °C

※ Please kindly note that our products are for research use only.