Dihydropalmatine

Dihydropalmatine

Inquiry
Catalog Number ACM26067607
CAS Number 26067-60-7
Molecular Weight 353.4
InChI InChI=1S/C21H23NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-11H,7-8,12H2,1-4H3
InChI Key PTPHDVKWAYIFRX-UHFFFAOYSA-N
Melting Point 170 °C
Complexity 524
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 353.16270821
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 353.16270821
PhysicalState Powder
Rotatable Bond Count 4
Topological Polar Surface Area 40.2 Ų
Custom Q&A

What is the chemical formula for Dihydropalmatine?

The chemical formula for Dihydropalmatine is C21H23NO4.

What is the molecular weight of Dihydropalmatine?

The molecular weight of Dihydropalmatine is 353.41.

What is the CAS number for Dihydropalmatine?

The CAS number for Dihydropalmatine is 26067-60-7.

What is the predicted boiling point of Dihydropalmatine?

The predicted boiling point of Dihydropalmatine is 555.8±50.0 °C.

What is the predicted melting point of Dihydropalmatine?

The predicted melting point of Dihydropalmatine is 170 °C.

What is the predicted density of Dihydropalmatine?

The predicted density of Dihydropalmatine is 1.25±0.1 g/cm3.

What is the predicted pka value of Dihydropalmatine?

The predicted pka value of Dihydropalmatine is 3.08±0.20.

What are the synonyms for Dihydropalmatine?

The synonyms for Dihydropalmatine include 6H-Dibenzo[a,g]quinolizine and 5,8-dihydro-2,3,9,10-tetramethoxy-.

Is Dihydropalmatine a solid, liquid, or gas at room temperature?

Dihydropalmatine is a solid at room temperature, with a predicted melting point of 170 °C.

What is the structure of Dihydropalmatine?

The structure of Dihydropalmatine can be represented by the chemical formula C21H23NO4.

※ Please kindly note that our products are for research use only.