Dihydroperaksine

Catalog Number	ACM16100848
CAS Number	16100-84-8
Molecular Weight	312.4
InChI	InChI=1S/C19H24N2O2/c1-10-14(8-22)12-6-18-19-13(7-17(21(10)18)15(12)9-23)11-4-2-3-5-16(11)20-19/h2-5,10,12,14-15,17-18,20,22-23H,6-9H2,1H3/t10-,12-,14-,15+,17-,18-/m0/s1
InChI Key	PBLXNPSLWYWTKM-KYGVLOPESA-N
Purity	95%+
Complexity	472
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	6
Exact Mass	312.183778013
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@H]1[C@@H]([C@@H]2C[C@@H]3N1[C@H]([C@@H]2CO)CC4=C3NC5=CC=CC=C45)CO
Monoisotopic Mass	312.183778013
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	59.5 Ų

Custom Q&A

What is the chemical formula of Dihydroperaksine?

The chemical formula of Dihydroperaksine is C19H24N2O2.

What is the molecular weight of Dihydroperaksine?

The molecular weight of Dihydroperaksine is 312.41 g/mol.

What is the CAS number of Dihydroperaksine?

The CAS number of Dihydroperaksine is 16100-84-8.

What is the predicted boiling point of Dihydroperaksine?

The predicted boiling point of Dihydroperaksine is 494.1 ± 40.0 °C.

In what solvents is Dihydroperaksine soluble?

Dihydroperaksine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted density of Dihydroperaksine?

The predicted density of Dihydroperaksine is 1.34 ± 0.1 g/cm3.

What is the form of Dihydroperaksine?

Dihydroperaksine is in powder form.

What is the predicted pka value of Dihydroperaksine?

The predicted pka value of Dihydroperaksine is 14.82 ± 0.10.

What are some synonyms for Dihydroperaksine?

Some synonyms for Dihydroperaksine are 18-Norsarpagan-17,19-diol, 19,20-dihydro-21-methyl-, (20α,21β)- and 19(S)20(R)-Dihydroperaksine.

※ Please kindly note that our products are for research use only.