1,3-Dihydroxy-2,4-diprenylacridone

Catalog Number	ACM1205687484
CAS Number	1205687-48-4
IUPAC Name	1,3-Dihydroxy-2,4-bis(3-methylbut-2-enyl)-10H-acridin-9-one
Molecular Weight	363.4
Molecular Formula	C23H25NO3
Canonical SMILES	CC(=CCC1=C2C(=C(C(=C1O)CC=C(C)C)O)C(=O)C3=CC=CC=C3N2)C
InChI	InChI=1S/C23H25NO3/c1-13(2)9-11-16-20-19(22(26)15-7-5-6-8-18(15)24-20)23(27)17(21(16)25)12-10-14(3)4/h5-10,25,27H,11-12H2,1-4H3,(H,24,26)
InChI Key	YJXSGTZSGZPDFU-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	603
Exact Mass	363.18344366
Heavy Atom Count	27
Monoisotopic Mass	363.18344366
Topological Polar Surface Area	69.6Ų

Custom Q&A

What is the chemical name of the compound 1,3-Dihydroxy-2,4-diprenylacridone?

The chemical name of the compound is 1,3-Dihydroxy-2,4-diprenylacridone.

What are the synonyms of 1,3-Dihydroxy-2,4-diprenylacridone?

The synonyms of 1,3-Dihydroxy-2,4-diprenylacridone are 1,3-dihydroxy-2,4-diprenylacridone and 9(10H)-Acridinone, 1,3-dihydroxy-2,4-bis(3-methyl-2-buten-1-yl)-.

What is the CAS number of 1,3-Dihydroxy-2,4-diprenylacridone?

The CAS number of 1,3-Dihydroxy-2,4-diprenylacridone is 1205687-48-4.

What is the molecular formula of 1,3-Dihydroxy-2,4-diprenylacridone?

The molecular formula of 1,3-Dihydroxy-2,4-diprenylacridone is C23H25NO3.

What is the molecular weight of 1,3-Dihydroxy-2,4-diprenylacridone?

The molecular weight of 1,3-Dihydroxy-2,4-diprenylacridone is 363.45.

What is the predicted boiling point of 1,3-Dihydroxy-2,4-diprenylacridone?

The predicted boiling point of 1,3-Dihydroxy-2,4-diprenylacridone is 569.1±50.0 °C.

What is the predicted density of 1,3-Dihydroxy-2,4-diprenylacridone?

The predicted density of 1,3-Dihydroxy-2,4-diprenylacridone is 1.183±0.06 g/cm3.

What is the predicted pka value of 1,3-Dihydroxy-2,4-diprenylacridone?

The predicted pka value of 1,3-Dihydroxy-2,4-diprenylacridone is 8.10±0.20.

How many oxygen atoms are present in the chemical structure of 1,3-Dihydroxy-2,4-diprenylacridone?

There are three oxygen atoms present in the chemical structure of 1,3-Dihydroxy-2,4-diprenylacridone.

How many carbon atoms are present in the chemical structure of 1,3-Dihydroxy-2,4-diprenylacridone?

There are 23 carbon atoms present in the chemical structure of 1,3-Dihydroxy-2,4-diprenylacridone.

※ Please kindly note that our products are for research use only.