Doxycycline

Doxycycline

Inquiry
Catalog Number ACM564250-1
CAS Number 564-25-0
Structure
Synonyms Vibramycin
IUPAC Name (4S,4aR,5S,5aR,6R,12aR)-4-(Dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide
Molecular Weight 444.4
Molecular Formula C22H24N2O8
Canonical SMILES CC1C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O
InChI InChI=1S/C22H24N2O8/c1-7-8-5-4-6-9(25)11(8)16(26)12-10(7)17(27)14-15(24(2)3)18(28)13(21(23)31)20(30)22(14,32)19(12)29/h4-7,10,14-15,17,25-27,30,32H,1-3H3,(H2,23,31)/t7-,10+,14+,15-,17-,22-/m0/s1
InChI Key SGKRLCUYIXIAHR-AKNGSSGZSA-N
Purity 98%+ (HPLC)
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 956
Exact Mass 444.15326573
Heavy Atom Count 32
Isomeric SMILES C[C@@H]1[C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O
Monoisotopic Mass 444.15326573
Topological Polar Surface Area 182Ų
Custom Q&A

What are the synonyms for Doxycycline?

Doxycyclin hyclate, Doxycycline Base&Hyclate, Doxycycline (base and/or unspecified salts), Doxychel, Monodox, Oracea, Vibramycin, Doxinyl.

What is the molecular formula of Doxycycline?

The molecular formula of Doxycycline is C22H24N2O8.

What is the solubility of Doxycycline in DMSO?

Doxycycline is soluble in DMSO at 125 mg/mL.

In what class of the Biopharmaceutics Classification System (BCS) does Doxycycline belong?

Doxycycline belongs in BCS Class 3.

What is the therapeutic function of Doxycycline?

Doxycycline is an antibiotic.

What is the antimicrobial activity of Doxycycline?

Doxycycline is active against some tetracycline-resistant Staph. aureus and more active than other tetracyclines against certain bacteria.

How is Doxycycline metabolized and excreted in the body?

Doxycycline is largely excreted unchanged, with around 35% eliminated through the kidneys and the remainder through the digestive tract.

What is the oral absorption percentage of Doxycycline?

The oral absorption percentage of Doxycycline is 90%.

What is the plasma half-life of Doxycycline?

The plasma half-life of Doxycycline is 18 hours.

In what areas of the body does Doxycycline achieve high tissue concentrations?

Doxycycline achieves high tissue concentrations in the liver, biliary system, kidneys, digestive tract, and various other tissues in the body.

※ Please kindly note that our products are for research use only.