(E)-Methyl 3-(1H-indol-3-yl)acrylate

Catalog Number	ACM19626927-1
CAS Number	19626-92-7
Structure
Synonyms	Indole-3-acrylic acid methyl ester
Molecular Weight	201.22
InChI	InChI=1S/C12H11NO2/c1-15-12(14)7-6-9-8-13-11-5-3-2-4-10(9)11/h2-8,13H,1H3/b7-6+
InChI Key	JKVXFZPEUCTHQO-VOTSOKGWSA-N
Purity	95%+
Complexity	262
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	201.078978594
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	COC(=O)/C=C/C1=CNC2=CC=CC=C21
Monoisotopic Mass	201.078978594
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	42.1 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 19626-92-7?

The chemical name of the compound is Indole-3-acrylic acid methyl ester.

What are some synonyms for Indole-3-acrylic acid methyl ester?

Some synonyms include (E)-Methyl 3-(1H-indol-3-yl)acrylate, 2-Propenoic acid, 3-(1H-indol-3-yl)-, methyl ester, and methyl(E)-3-(1H-indol-3-yl)prop-2-enoate.

What is the molecular formula of Indole-3-acrylic acid methyl ester?

The molecular formula is C12H11NO2.

What is the molecular weight of Indole-3-acrylic acid methyl ester?

The molecular weight is 201.22.

What is the melting point of Indole-3-acrylic acid methyl ester?

The melting point is 152-153 °C.

What is the boiling point of Indole-3-acrylic acid methyl ester predicted to be?

The predicted boiling point is 387.1±17.0 °C.

What is the density of Indole-3-acrylic acid methyl ester predicted to be?

The predicted density is 1.235±0.06 g/cm3.

What is the storage temperature recommended for Indole-3-acrylic acid methyl ester?

The recommended storage temperature is 2-8°C.

What is the predicted pka value of Indole-3-acrylic acid methyl ester?

The predicted pka value is 16.19±0.30.

What is a common use of Indole-3-acrylic acid methyl ester?

It is used as a reagent in the preparation of pyridazinoindoles as anxiolytics.

※ Please kindly note that our products are for research use only.