(-)-Eburnamonine

Catalog Number	ACM4880880
CAS Number	4880-88-0
Description	(-)-Eburnamonine is a natural product that is obtained from the roots of Eucalyptus globulus. It is an inhibitor of sodium citrate, which is used in the treatment of infectious diseases. (-)-Eburnamonine has been shown to be effective against intestinal inflammation and bowel disease by reducing the production of inflammatory cytokines. The molecule also inhibits hydroxyl group formation and has been shown to have minimal toxicity in animal studies. It also affects brain functions, such as energy metabolism, and may have significant cytotoxicity against cancer cells.
Molecular Weight	294.39 g/mol
Molecular Formula	C19H22N2O
Canonical SMILES	CC[C@@]12CCCN3[C@@H]1C4=C(CC3)C5=CC=CC=C5N4C(=O)C2
Storage	store at <-15℃, close container well
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2939799090 - China: 2939799099
MDL Number	MFCD00064309

Custom Q&A

What is the chemical formula of (-)-Eburnamonine?

The chemical formula of (-)-Eburnamonine is C19H22N2O.

What is the molecular weight of (-)-Eburnamonine?

The molecular weight of (-)-Eburnamonine is 294.39.

What is the melting point of (-)-Eburnamonine?

The melting point of (-)-Eburnamonine is 174-177 °C.

How is the solubility of (-)-Eburnamonine in chloroform?

(-)-Eburnamonine is slightly soluble in chloroform.

What is the therapeutic function of (-)-Eburnamonine?

(-)-Eburnamonine is used as a cerebrotonic.

Who is the originator of (-)-Eburnamonine?

Euburnamonine, Shanghai Lansheng Corporation, is the originator of (-)-Eburnamonine.

What are the safety statements associated with (-)-Eburnamonine?

The safety statements associated with (-)-Eburnamonine are 22-24/25.

What is the usage of (-)-Eburnamonine?

(-)-Eburnamonine is used as a cerebral vasodilator.

What is the boiling point of (-)-Eburnamonine?

The boiling point of (-)-Eburnamonine is approximately 436.16°C.

How is the density of (-)-Eburnamonine?

The density of (-)-Eburnamonine is 1.34.

※ Please kindly note that our products are for research use only.