Ellipticine

Catalog Number	ACM519233-1
CAS Number	519-23-3
Description	Ellipticine is a natural product that inhibits the activity of the P-glycoprotein (P-gp) transporter. It binds to the guanine residues in cells, thereby inhibiting cellular functions. Ellipticine has been shown to inhibit mitochondrial function, leading to cell death by apoptosis and necrosis. Ellipticine also binds to DNA, intercalating between nucleotide bases and preventing DNA replication. This compound is active against a broad range of cancer cell lines, including those resistant to other chemotherapeutic agents such as cisplatin.
Synonyms	5,11-Dimethyl-6H-pyrido[4,3-b]carbazole
Molecular Weight	246.31 g/mol
Molecular Formula	C17H14N2
Canonical SMILES	CC1=C2C=CN=CC2=C(C3=C1NC4=CC=CC=C43)C
Harmonized Tariff Code	Switzerland: 29339980 - USA: 2933999701 - Slovakia: 2933998090 - UK: 2933998090 - China: 2933990099
MDL Number	MFCD00010524

Custom Q&A

What is the chemical formula of Ellipticine?

The chemical formula of Ellipticine is C17H14N2.

What is the melting point of Ellipticine?

The melting point of Ellipticine is 316-318°C.

How is Ellipticine stored?

Ellipticine should be kept in a dark place, sealed in a dry environment, and stored at 2-8°C.

What is the primary use of Ellipticine?

Ellipticine is a DNA intercalating agent and exhibits antitumor activities.

How does Ellipticine inhibit tumor growth?

Ellipticine inhibits tumor growth by intercalating into DNA and/or inhibiting DNA topoisomerase II.

What are the major safety hazards associated with Ellipticine?

Ellipticine is classified under hazard code T, with risk statements 25 and safety statements 45.

What is the boiling point of Ellipticine?

The boiling point of Ellipticine is estimated to be 379.31°C.

How is Ellipticine synthesized?

Ellipticine synthesis can be found in references such as the Journal of the American Chemical Society and The Journal of Organic Chemistry.

What is the IC50 value of Ellipticine for inhibiting the proliferation of human breast adenocarcinoma MCF-7 cells?

The IC50 value of Ellipticine for inhibiting the proliferation of human breast adenocarcinoma MCF-7 cells is between 0.27-4.7 μM.

How is Ellipticine purified?

Ellipticine can be purified by recrystallization from CHCl3 or MeOH and drying in vacuo.

※ Please kindly note that our products are for research use only.