Emeheterone

Emeheterone

Inquiry
Catalog Number ACM117333127
CAS Number 117333-12-7
Structure
Synonyms 5-Methoxy-3,6-dibenzylpyrazin-2(1H)-one 4-oxide
Molecular Weight 322.4
InChI InChI=1S/C19H18N2O3/c1-24-19-16(12-14-8-4-2-5-9-14)20-18(22)17(21(19)23)13-15-10-6-3-7-11-15/h2-11H,12-13H2,1H3,(H,20,22)
InChI Key JXYUVGGSKHTJHO-UHFFFAOYSA-N
Purity 95%+
Complexity 527
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 322.13174244
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 1
Monoisotopic Mass 322.13174244
PhysicalState Powder
Rotatable Bond Count 5
Topological Polar Surface Area 67.1 Ų
Custom Q&A

What is the chemical structure of Emeheterone?

The chemical structure of Emeheterone is C19H18N2O3.

What is the molecular weight of Emeheterone?

The molecular weight of Emeheterone is 322.36 g/mol.

What is the CAS number of Emeheterone?

The CAS number of Emeheterone is 117333-12-7.

What are the synonyms for Emeheterone?

The synonyms for Emeheterone are 5-Methoxy-3,6-dibenzylpyrazin-2(1H)-one 4-oxide and 2(1H)-Pyrazinone, 5-methoxy-3,6-bis(phenylmethyl)-, 4-oxide.

What is the chemical formula of Emeheterone?

The chemical formula of Emeheterone is C19H18N2O3.

What is the common name for 5-Methoxy-3,6-dibenzylpyrazin-2(1H)-one 4-oxide?

The common name for 5-Methoxy-3,6-dibenzylpyrazin-2(1H)-one 4-oxide is Emeheterone.

How many phenylmethyl groups are present in Emeheterone?

Emeheterone contains two phenylmethyl groups.

What is the origin of the name "Emeheterone"?

The name Emeheterone is likely derived from the chemical structure of the compound.

※ Please kindly note that our products are for research use only.