Entadamide A glucoside

Catalog Number	ACM138916582
CAS Number	138916-58-2
Synonyms	(E)-N-[2-(β-D-Glucopyranosyloxy)ethyl]-3-methylthiopropenamide
Molecular Weight	323.36
InChI	InChI=1S/C12H21NO7S/c1-21-5-2-8(15)13-3-4-19-12-11(18)10(17)9(16)7(6-14)20-12/h2,5,7,9-12,14,16-18H,3-4,6H2,1H3,(H,13,15)
InChI Key	FISKBHZVUFLWDZ-UHFFFAOYSA-N
Purity	95%+
Complexity	355
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	323.10387318
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	5
Monoisotopic Mass	323.10387318
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	154 Ų

Custom Q&A

What is the chemical name of the compound Entadamide A glucoside?

The chemical name of the compound is (E)-N-[2-(β-D-Glucopyranosyloxy)ethyl]-3-methylthiopropenamide.

What are some synonyms of Entadamide A glucoside?

Some synonyms of Entadamide A glucoside are Entadamide A-β-D-glucopyranoside, Cannabinoid A, and Entadamide A-beta-D-glucopyranoside.

What is the CAS number of Entadamide A glucoside?

The CAS number of Entadamide A glucoside is 138916-58-2.

What is the molecular formula of Entadamide A glucoside?

The molecular formula of Entadamide A glucoside is C12H21NO7S.

What is the molar mass of Entadamide A glucoside?

The molar mass of Entadamide A glucoside is 323.36 g/mol.

What is the predicted boiling point of Entadamide A glucoside?

The predicted boiling point of Entadamide A glucoside is 627.7±55.0 °C.

What is the predicted density of Entadamide A glucoside?

The predicted density of Entadamide A glucoside is 1.43±0.1 g/cm3.

What is the predicted pka value of Entadamide A glucoside?

The predicted pka value of Entadamide A glucoside is 12.90±0.70.

What functional groups are present in Entadamide A glucoside?

The functional groups present in Entadamide A glucoside are a thiopropene group and a glucopyranose group.

What is the structure of Entadamide A glucoside?

The structure of Entadamide A glucoside contains a thioalkene moiety attached to a glucopyranose group through an ethyl linker.

※ Please kindly note that our products are for research use only.