Epi-galanthamine

Catalog Number	ACM1668855-1
CAS Number	1668-85-5
Description	Metabolite of galanthamine; less active inhibitor of acetylcholinesterase
Synonyms	(4aS,6S,8aS)-4a,5,9,10,11,12-Hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-ol2-Epigalanthamine(-)-Epigalant hamine
Molecular Weight	287.35 g/mol
Molecular Formula	C17H21NO3
Canonical SMILES	CN1CC[C@@]23C=C[C@H](C[C@@H]2OC4=C(C=CC(=C34)C1)OC)O
Storage	store at <-15℃
Harmonized Tariff Code	Switzerland: 29349999 - USA: 2934999001 - Slovakia: 2934999090 - UK: 2934999090 - China: 2934999099
MDL Number	MFCD06796695

Custom Q&A

What is the chemical formula for EPI-GALANTHAMINE?

The chemical formula for EPI-GALANTHAMINE is C17H21NO3.

What is the molecular weight of EPI-GALANTHAMINE?

The molecular weight of EPI-GALANTHAMINE is 287.35 g/mol.

What are some synonyms for EPI-GALANTHAMINE?

Some synonyms for EPI-GALANTHAMINE include SPH 1068, Galantamine EP impurity B, and 3-EpigalanthaMine.

What is the melting point of EPI-GALANTHAMINE?

The melting point of EPI-GALANTHAMINE is 183-185°C.

What is the solubility of EPI-GALANTHAMINE in chloroform and methanol?

EPI-GALANTHAMINE is slightly soluble in chloroform and methanol.

What is the pKa value of EPI-GALANTHAMINE?

The pKa value of EPI-GALANTHAMINE is 13.93±0.20.

What is the storage temperature recommended for EPI-GALANTHAMINE?

The recommended storage temperature for EPI-GALANTHAMINE is -20°C in the freezer.

What is the color of EPI-GALANTHAMINE?

EPI-GALANTHAMINE is white to off-white in color.

What are some of the product categories that EPI-GALANTHAMINE belongs to?

EPI-GALANTHAMINE belongs to the categories of Pharmaceuticals, Chiral Reagents, and Inhibitors.

What is the main use of EPI-GALANTHAMINE?

EPI-GALANTHAMINE is a selective acetylcholinesterase inhibitor.

※ Please kindly note that our products are for research use only.