Epiberberine chloride

Epiberberine chloride

Inquiry
Catalog Number ACM889665865
CAS Number 889665-86-5
Structure
Molecular Weight 371.8
InChI InChI=1S/C20H18NO4.ClH/c1-22-18-8-13-5-6-21-10-15-12(3-4-17-20(15)25-11-24-17)7-16(21)14(13)9-19(18)23-2;/h3-4,7-10H,5-6,11H2,1-2H3;1H/q+1;/p-1
InChI Key DGRBIBRPLDAHJH-UHFFFAOYSA-M
Purity 95%+
Complexity 488
Covalently-Bonded Unit Count 2
Defined Atom Stereocenter Count 0
Exact Mass 371.0924357
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 371.0924357
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 40.8 Ų
Custom Q&A

What is the chemical name of epiberberine?

The chemical name of epiberberine is 11,12-Dihydro-8,9-dimethoxybenzo[a]-1,3-benzodioxolo[4,5-g]quinolizinium.

What is the CAS number for epiberberine?

The CAS number for epiberberine is 6873-09-2.

What are some synonyms for epiberberine?

Some synonyms for epiberberine include BerbiniuM, Siberian, and Epiberberine Chloride.

What are the molecular formula and weight of epiberberine?

The molecular formula of epiberberine is C20H18NO4+ and its molecular weight is 336.36122.

What are the solubility properties of epiberberine?

Epiberberine is slightly soluble in DMSO and methanol.

What is the melting point of epiberberine?

The melting point of epiberberine is 260℃.

What is the main usage of epiberberine?

Epiberberine is used as a natural bioactive alkaloid with chemopreventive properties against colon tumor formation.

What enzyme does epiberberine inhibit to prevent colon tumor formation?

Epiberberine inhibits the enzyme cyclooxygenase-2 (cox-2) to prevent colon tumor formation.

What are the targets of epiberberine in the body?

The targets of epiberberine in the body include MEK, ERK, AMPK, Akt, Fatty Acid Synthase, Raf, P450, LDL, HMG-CoA Reductase, AChE, BACE, and ROS.

In what form and color does epiberberine exist?

Epiberberine exists in solid form and is orange to dark orange in color.

※ Please kindly note that our products are for research use only.