Epigoitrin

Catalog Number	ACM1072931
CAS Number	1072-93-1
Structure
Description	Epigoitrin is a natural alkaloid from Isatis tinctoria, with antiviral activities. Epigoitrin reduces susceptibility to influenza virus via mitochondrial antiviral signaling.
Synonyms	(5R)-5-Vinyloxazolidine-2-thione
Molecular Weight	129.18
Molecular Formula	C5H7NOS
Canonical SMILES	S=C1O[C@H](C=C)CN1
InChI	InChI=1S/C5H7NOS/c1-2-4-3-6-5(8)7-4/h2,4H,1,3H2,(H,6,8)/t4-/m1/s1
InChI Key	UZQVYLOFLQICCT-SCSAIBSYSA-N
Melting Point	47.5 °C
Purity	95%+
Appearance	Solid
Storage	4°C, protect from light*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light).
Complexity	124
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	129.02483502
Heavy Atom Count	8
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C=C[C@@H]1CNC(=S)O1
Monoisotopic Mass	129.02483502
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	53.4 Ų

Custom Q&A

What is the chemical formula for goitrine?

The chemical formula for goitrine is C5H7NOS.

What is the molecular weight of goitrine?

The molecular weight of goitrine is 129.18.

What are some synonyms for goitrine?

Some synonyms for goitrine include R-goitrin, 5-vinyl-2-thiooxazolidone, and BA-51-090278.

What is the melting point of goitrine?

The melting point of goitrine is 47.5°C.

What is the boiling point of goitrine?

The predicted boiling point of goitrine is 150.6±43.0°C.

In what form does goitrine exist?

Goitrine exists in the form of a solid.

What is the storage temperature recommended for goitrine?

Goitrine should be stored in an amber vial at -20°C freezer.

What is goitrine known for reducing the production of?

Goitrine is known for reducing the production of thyroid hormones.

What is the target of goitrine?

The target of goitrine is the influenza virus.

What is the safety statement associated with goitrine?

The safety statement associated with goitrine is 24/25.

※ Please kindly note that our products are for research use only.