Epistephamiersine

Catalog Number	ACM52389158
CAS Number	52389-15-8
Synonyms	(7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one
Molecular Weight	389.4
InChI	InChI=1S/C21H27NO6/c1-22-9-8-19-10-13(23)18(26-4)21(27-5)20(19,22)11-15(28-21)12-6-7-14(24-2)17(25-3)16(12)19/h6-7,15,18H,8-11H2,1-5H3/t15-,18-,19-,20-,21-/m0/s1
InChI Key	UTTZNWQGZHNUIG-JMMIECQRSA-N
Purity	95%+
Complexity	673
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	389.18383758
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	CN1CC[C@@]23[C@]14C[C@@H](C5=C2C(=C(C=C5)OC)OC)O[C@]4([C@H](C(=O)C3)OC)OC
Monoisotopic Mass	389.18383758
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	66.5 Ų

Custom Q&A

What is the chemical name of Epistephamiersine?

The chemical name of Epistephamiersine is (7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one.

What are some synonyms for Epistephamiersine?

Some synonyms for (7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one are Epistephamiersine and Hasubanan-6-one, 8,10-epoxy-3,4,7,8-tetramethoxy-17-methyl-.

What is the molecular formula of Epistephamiersine?

The molecular formula of (7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one is C21H27NO6.

What is the molecular weight of Epistephamiersine?

The molecular weight of this compound is 389.45.

What is the boiling point of (7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one?

The boiling point of (7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one is predicted to be 532.7±50.0 °C.

In what solvents is (7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one soluble?

(7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

In what form is this compound typically found?

This compound is typically found in powder form.

What is the predicted pka of (7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one?

The predicted pka of (7S)-8β,10β-Epoxy-3,4,7,8-tetramethoxy-17-methylhasubanan-6-one is 6±0.60.

What is the predicted density of Epistephamiersine?

The predicted density of Epistephamiersine is 1.31±0.1 g/cm3.

※ Please kindly note that our products are for research use only.