Erianin

Catalog Number	ACM95041900-1
CAS Number	95041-90-0
Synonyms	2-Methoxy-5-(3,4,5-trimethoxyphenethyl)phenol
IUPAC Name	2-Methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol
Molecular Weight	318.4
Molecular Formula	C18H22O5
Canonical SMILES	COC1=C(C=C(C=C1)CCC2=CC(=C(C(=C2)OC)OC)OC)O
InChI	InChI=1S/C18H22O5/c1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3/h7-11,19H,5-6H2,1-4H3
InChI Key	UXDFUVFNIAJEGM-UHFFFAOYSA-N
Purity	98%+(HPLC)
Appearance	Colorless crystalline powder
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	323
Exact Mass	318.14672380
Heavy Atom Count	23
Monoisotopic Mass	318.14672380
Topological Polar Surface Area	57.2Ų

Custom Q&A

What is the melting point of Erianin?

The melting point of Erianin is 82-85°C.

What is the storage temperature recommended for Erianin?

The recommended storage temperature for Erianin is -20°C in a freezer.

In what form does Erianin exist?

Erianin exists in solid form.

What colors is Erianin typically?

Erianin is typically white in color.

What solvents is Erianin slightly soluble in?

Erianin is slightly soluble in chloroform and methanol.

What is the main usage of Erianin?

The main usage of Erianin is as a promising anticancer agent.

How does Erianin act as an anticancer agent?

Erianin acts as an anticancer agent by strongly inhibiting tubulin polymerization in cell mitosis.

What is a key property of Erianin that makes it effective as an anticancer agent?

Erianin's cytotoxic nature contributes to its effectiveness as an anticancer agent.

※ Please kindly note that our products are for research use only.