Erianin

Erianin

Inquiry
Catalog Number ACM95041900-1
CAS Number 95041-90-0
Structure
Synonyms 2-Methoxy-5-(3,4,5-trimethoxyphenethyl)phenol
IUPAC Name 2-Methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethyl]phenol
Molecular Weight 318.4
Molecular Formula C18H22O5
Canonical SMILES COC1=C(C=C(C=C1)CCC2=CC(=C(C(=C2)OC)OC)OC)O
InChI InChI=1S/C18H22O5/c1-20-15-8-7-12(9-14(15)19)5-6-13-10-16(21-2)18(23-4)17(11-13)22-3/h7-11,19H,5-6H2,1-4H3
InChI Key UXDFUVFNIAJEGM-UHFFFAOYSA-N
Purity 98%+(HPLC)
Appearance Colorless crystalline powder
Storage Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity 323
Exact Mass 318.14672380
Heavy Atom Count 23
Monoisotopic Mass 318.14672380
Topological Polar Surface Area 57.2Ų
Custom Q&A

What is the melting point of Erianin?

The melting point of Erianin is 82-85°C.

What is the storage temperature recommended for Erianin?

The recommended storage temperature for Erianin is -20°C in a freezer.

In what form does Erianin exist?

Erianin exists in solid form.

What colors is Erianin typically?

Erianin is typically white in color.

What solvents is Erianin slightly soluble in?

Erianin is slightly soluble in chloroform and methanol.

What is the main usage of Erianin?

The main usage of Erianin is as a promising anticancer agent.

How does Erianin act as an anticancer agent?

Erianin acts as an anticancer agent by strongly inhibiting tubulin polymerization in cell mitosis.

What is a key property of Erianin that makes it effective as an anticancer agent?

Erianin's cytotoxic nature contributes to its effectiveness as an anticancer agent.

※ Please kindly note that our products are for research use only.