Erycibelline

Catalog Number	ACM107633954
CAS Number	107633-95-4
Structure
Molecular Weight	143.18
InChI	InChI=1S/C7H13NO2/c9-5-2-1-4-3-6(10)7(5)8-4/h4-10H,1-3H2
InChI Key	GXCZZQGJZNJSBW-UHFFFAOYSA-N
Purity	95%+
Complexity	140
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	143.094628657
Heavy Atom Count	10
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Monoisotopic Mass	143.094628657
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	52.5 Ų

Custom Q&A

What is the chemical name for erycibelline?

The chemical name for erycibelline is 8-Azabicyclo[3.2.1]octane-2,7-diol, (1S,2S,5R,7R)-.

What are some synonyms for erycibelline?

Some synonyms for erycibelline include erycibelline and 8-Azabicyclo[3.2.1]octane-2,7-diol, (1S,2S,5R,7R)-.

What is the CAS number for erycibelline?

The CAS number for erycibelline is 107633-95-4.

What is the molecular formula for erycibelline?

The molecular formula for erycibelline is C7H13NO2.

What is the molecular weight of erycibelline?

The molecular weight of erycibelline is 143.18.

What is the chemical structure of erycibelline?

The chemical structure of erycibelline is 8-Azabicyclo[3.2.1]octane-2,7-diol, with a specific stereochemistry (1S,2S,5R,7R).

What is the significance of the stereochemistry (1S,2S,5R,7R) in erycibelline?

The stereochemistry (1S,2S,5R,7R) indicates the specific arrangement of atoms in the molecule, which can affect its biological activity and properties.

How is erycibelline used in research or industrial applications?

Erycibelline may be used in research for studying its pharmacological effects or in industrial applications for synthesis of other compounds.

Are there any known side effects or contraindications associated with erycibelline?

As the reference did not provide information on this topic specifically, it is recommended to consult with a healthcare professional or refer to more comprehensive sources for safety information on erycibelline.

※ Please kindly note that our products are for research use only.