Ethyl beta-carboline-1-propionate

Catalog Number	ACM90686241
CAS Number	90686-24-1
Synonyms	Beta-carboline-1-propionic acid, ethyl ester
Molecular Weight	268.31
InChI	InChI=1S/C16H16N2O2/c1-2-20-15(19)8-7-14-16-12(9-10-17-14)11-5-3-4-6-13(11)18-16/h3-6,9-10,18H,2,7-8H2,1H3
InChI Key	MVOYJHIRYQUBIR-UHFFFAOYSA-N
Purity	95%+
Complexity	347
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	268.121177757
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	268.121177757
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	55 Ų

Custom Q&A

What is the chemical name for the compound with the CAS number 90686-24-1?

The chemical name for the compound is Beta-Carboline-1-propionic acid, ethyl ester.

What is another name for the compound?

Another name for the compound is Ethyl beta-carboline-1-propionate.

What is the molecular formula of the compound?

The molecular formula of the compound is C16H16N2O2.

What is the molecular weight of the compound?

The molecular weight of the compound is 268.31 g/mol.

What is the IUPAC name for the compound?

The IUPAC name for the compound is 9H-Pyrido[3,4-b]indole-1-propanoic acid, ethyl ester.

What are some synonyms for the compound?

Some synonyms for the compound are Beta-Carboline-1-propionic acid, ethyl ester; Ethyl beta-carboline-1-propionate.

What is the significance of the ethyl ester group in the compound?

The ethyl ester group is important as it signifies the presence of an ester functional group in the compound.

Why is knowing the CAS number of a compound important?

The CAS number helps identify a unique chemical substance and is used for database searches and regulatory purposes.

How can Ethyl beta-carboline-1-propionate be used in scientific research or industry?

Ethyl beta-carboline-1-propionate can be used as a reference standard, in chemical reactions, or in pharmacological studies related to beta-carbolines.

※ Please kindly note that our products are for research use only.