Euonymine

Catalog Number	ACM33458821
CAS Number	33458-82-1
Synonyms	Evonine
Molecular Weight	805.8
InChI	InChI=1S/C38H47NO18/c1-16-17(2)33(46)56-30-28(52-20(5)42)32(55-23(8)45)37(15-49-18(3)40)31(54-22(7)44)27(51-19(4)41)25-29(53-21(6)43)38(37,36(30,10)48)57-35(25,9)14-50-34(47)24-12-11-13-39-26(16)24/h11-13,16-17,25,27-32,48H,14-15H2,1-10H3/t16-,17-,25+,27+,28-,29+,30-,31+,32-,35-,36?,37+,38-/m0/s1
InChI Key	PBFGAFDJVQAMRS-KCYQGYFWSA-N
Purity	90%+
Complexity	1680
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	12
Exact Mass	805.27931365
Heavy Atom Count	57
Hydrogen Bond Acceptor Count	19
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@H]1[C@@H](C(=O)O[C@H]2[C@@H]([C@@H]([C@]3([C@@H]([C@@H]([C@@H]4[C@H]([C@@]3(C2(C)O)O[C@]4(COC(=O)C5=C1N=CC=C5)C)OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C
Monoisotopic Mass	805.27931365
PhysicalState	Powder
Rotatable Bond Count	13
Topological Polar Surface Area	253 Ų

Custom Q&A

What is the chemical formula of Evonine?

The chemical formula of Evonine is C38H47NO18.

What is the molecular weight of Evonine?

The molecular weight of Evonine is 805.78.

What is the boiling point of Evonine?

The boiling point of Evonine is predicted to be 799.6±60.0 °C.

What is the density of Evonine?

The density of Evonine is predicted to be 1.40±0.1 g/cm3.

What is the pka value of Evonine?

The pka value of Evonine is predicted to be 11.75±0.70.

What is the CAS number of Evonine?

The CAS number of Evonine is 33458-82-1.

Where is Evonine found naturally?

Evonine is a natural product found in Maytenus mekongensis.

What are some synonyms for Evonine?

Some synonyms for Evonine include enouymine, Euonymine, and Euonymin.

What is the systematic name of Evonine?

The systematic name of Evonine is 8,11-Epoxy-9,12-ethano-11,15-methano-11H-[1,8]dioxacycloheptadecino[4,3-b]pyridine-5,17-dione, 10,13,14,21,22-pentakis(acetyloxy)-12-[(acetyloxy)methyl]-7,8,9,10,12,13,14,15,18,19-decahydro-20-hydroxy-8,18,19,20-tetramethyl-, (8R,9R,10R,11S,12S,13R,14R,15S,18S,19S,20S,21S,22R)-.

What can Evonine be used for?

Evonine can be used for various chemical and pharmaceutical applications due to its properties and structure.

※ Please kindly note that our products are for research use only.