Evocarpine

Catalog Number	ACM15266383
CAS Number	15266-38-3
Synonyms	1-Methyl-2-[(Z)-tridec-8-enyl]quinolin-4-one
Molecular Weight	339.5
InChI	InChI=1S/C23H33NO/c1-3-4-5-6-7-8-9-10-11-12-13-16-20-19-23(25)21-17-14-15-18-22(21)24(20)2/h6-7,14-15,17-19H,3-5,8-13,16H2,1-2H3/b7-6-
InChI Key	HWFYWIVOYBPLQU-SREVYHEPSA-N
Melting Point	34-38 °C
Purity	98%+
Complexity	451
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	339.256214676
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	CCCC/C=C\CCCCCCCC1=CC(=O)C2=CC=CC=C2N1C
Monoisotopic Mass	339.256214676
PhysicalState	Powder
Rotatable Bond Count	11
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the chemical formula for evocarpine?

The chemical formula for evocarpine is C23H33NO.

What is the molecular weight of evocarpine?

The molecular weight of evocarpine is 339.51.

What is the melting point of evocarpine?

The melting point of evocarpine is 34-38℃.

What is the boiling point of evocarpine?

The boiling point of evocarpine is 456.2±45.0 °C (Predicted).

What is the storage temperature recommended for evocarpine?

The storage temperature recommended for evocarpine is 2-8°C.

What is the predicted pka value of evocarpine?

The predicted pka value of evocarpine is 2.52±0.70.

What is evocarpine used for?

Evocarpine is a member of quinolines.

Are there any synonyms for evocarpine?

Yes, some synonyms for evocarpine include 1-Methyl-2-[(Z)-8-tridecene-1-yl]quinoline-4(1H)-one and 1-Methyl-2-[(Z)-8-tridecenyl]-4(1H)-quinolinone.

What is the CAS number for evocarpine?

The CAS number for evocarpine is 15266-38-3.

What is the density of evocarpine at 20°C and 760 Torr?

The density of evocarpine at 20°C and 760 Torr is 0.975±0.06 g/cm3.

※ Please kindly note that our products are for research use only.