Evodiamine

Catalog Number	ACM518172
CAS Number	518-17-2
Structure
Description	Evodiamine is a natural compound with apoptotic activity. It has been found to induce apoptosis in human osteosarcoma cells by binding to pro-apoptotic protein, leading to the activation of caspases and downregulation of Bcl-2. Evodiamine also has synergistic effects with other drugs that induce apoptosis, such as dextran sulfate, an anticancer drug. This compound has shown promising results in clinical trials for breast cancer and resistant breast cancer. The mechanism of action of evodiamine is not fully understood but it may involve autophagy or the induction of plate test. Evodiamine may also have anti-infectious properties due to its ability to inhibit bacteria growth by interfering with DNA binding activity and protein synthesis.
Molecular Weight	303.36 g/mol
Molecular Formula	C19H17N3O
Canonical SMILES	CN1[C@@H]2C3=C(CCN2C(=O)C4=CC=CC=C41)C5=CC=CC=C5N3
Storage	store at 2℃-8℃
Harmonized Tariff Code	UK: 2939990090 -
MDL Number	MFCD00016673

Custom Q&A

What is the chemical formula of Evodiamine?

The chemical formula of Evodiamine is C19H17N3O.

What is the molecular weight of Evodiamine?

The molecular weight of Evodiamine is 303.36 g/mol.

What is the melting point of Evodiamine?

The melting point of Evodiamine is 278°C.

What is the solubility of Evodiamine?

Evodiamine is soluble in DMSO (up to 5 mg/ml).

How is Evodiamine extracted from Evodia?

Evodiamine is extracted and isolated from the fruit of Rutaceae Evodia rutaecarpa.

What are the pharmacological effects of Evodiamine?

The pharmacological effects of Evodiamine include anti-tumor, heart protection, weight loss, anti-inflammatory, analgesic, and anti-senile dementia properties.

What is the chemical synthesis process of Evodiamine?

Evodiamine is synthesized using N-methyl anthranilic acid as the starting material, which undergoes acylation and other steps to produce Evodiamine.

How does Evodiamine inhibit tumor cell proliferation?

Evodiamine inhibits tumor cell proliferation by inducing cell cycle arrest in the G2/M period and promoting apoptosis through various pathways.

How does Evodiamine impact the endocrine system?

Evodiamine reduces the activity of intracellular cyclic adenosine monophosphate (cAMP)-related pathways and influences steroid-related enzymes and hormone secretion.

What effects does Evodiamine have on the cardiovascular system?

Evodiamine can have effects on the heart, blood pressure, and can inhibit the release of aldosterone to affect blood pressure.

※ Please kindly note that our products are for research use only.