Evodine

Evodine

Inquiry
Catalog Number ACM6989384
CAS Number 6989-38-4
Structure
Synonyms (-)-1-[(4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl)oxy]-3-methyl-3-buten-2-ol
Molecular Weight 329.3
InChI InChI=1S/C18H19NO5/c1-10(2)13(20)9-24-14-6-5-11-15(17(14)22-4)19-18-12(7-8-23-18)16(11)21-3/h5-8,13,20H,1,9H2,2-4H3
InChI Key LNJTUUHDKCPQAA-UHFFFAOYSA-N
Melting Point 153-154 ºC
Purity 95%+
Complexity 445
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 329.12632271
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 1
Monoisotopic Mass 329.12632271
PhysicalState Powder
Rotatable Bond Count 6
Topological Polar Surface Area 74 Ų
Custom Q&A

What is the chemical formula of Evodine?

The chemical formula of Evodine is C18H19NO5.

What is the molecular weight of Evodine?

The molecular weight of Evodine is 329.35.

What is the melting point of Evodine?

The melting point of Evodine is 153-154 ºC.

What is the boiling point of Evodine?

The boiling point of Evodine is predicted to be 507.0±50.0 °C.

How should Evodine be stored?

Evodine should be stored at -20°C.

In what form does Evodine exist?

Evodine exists in the form of a powder.

What is the solubility of Evodine in DMSO?

Evodine is soluble in DMSO at a concentration of 66 mg/mL (200.39 mM).

What is the pka of Evodine?

The pka of Evodine is predicted to be 13.26±0.20.

Where can Evodine be found naturally?

Evodine can be found in extracts from Evodia rutaecarpa.

What activity is associated with Evodine when found in extracts from Evodia rutaecarpa?

Evodine displays antinociceptive activity, particularly related to concentrations of evodine.

※ Please kindly note that our products are for research use only.