Fenfangjine G

Catalog Number	ACM205533819
CAS Number	205533-81-9
Molecular Weight	433.5
InChI	InChI=1S/C22H27NO8/c1-10(24)30-14-9-22-7-8-23-17(16(22)21(29-4)20(14)31-11(2)25)18(26)12-5-6-13(28-3)19(27)15(12)22/h5-6,14,17-18,20,23,26-27H,7-9H2,1-4H3/t14,17-,18,20,22+/m1/s1
InChI Key	YVYLKUBETBPYFU-BQMSLCBESA-N
Purity	95%+
Complexity	769
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	433.17366682
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	3
Isomeric SMILES	CC(=O)OC1C[C@]23CCN[C@H](C2=C(C1OC(=O)C)OC)C(C4=C3C(=C(C=C4)OC)O)O
Monoisotopic Mass	433.17366682
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	124 Ų

Custom Q&A

What is the chemical name for Fenfangjine G?

The chemical name for Fenfangjine G is Morphinan-4,6,7,10-tetrol, 8,14-didehydro-3,8-dimethoxy-, 6,7-diacetate, (6α,7β,9α,10β,13α)-

What is the CAS number for Fenfangjine G?

The CAS number for Fenfangjine G is 205533-81-9

What is the molecular formula and molecular weight of Fenfangjine G?

The molecular formula of Fenfangjine G is C22H27NO8 and the molecular weight is 433.46

What is the predicted boiling point of Fenfangjine G?

The predicted boiling point of Fenfangjine G is 625.7±55.0 °C

In what solvents is Fenfangjine G soluble?

Fenfangjine G is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the predicted density of Fenfangjine G?

The predicted density of Fenfangjine G is 1.39±0.1 g/cm3

What is the form of Fenfangjine G?

Fenfangjine G exists in the form of powder.

What is the predicted pKa value of Fenfangjine G?

The predicted pKa value of Fenfangjine G is 9.63±0.70

What are some common synonyms for Fenfangjine G?

Fenfangjine G can also be referred to as Fenfangjine G

Are there any specific safety precautions or handling instructions mentioned for Fenfangjine G in the reference?

No specific safety precautions or handling instructions are provided in the reference for Fenfangjine G.

※ Please kindly note that our products are for research use only.