Ferrugine

Catalog Number	ACM58471117
CAS Number	58471-11-7
Molecular Weight	229.32
InChI	InChI=1S/C15H19NO/c1-16-12-7-9-13(14(16)10-8-12)15(17)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3
InChI Key	FKBXXVPBVMWIDS-UHFFFAOYSA-N
Purity	95%+
Complexity	295
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	229.14666423
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	229.14666423
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the chemical formula of Ferrugine?

The chemical formula of Ferrugine is C15H19NO.

What is the molecular weight of Ferrugine?

The molecular weight of Ferrugine is 229.32.

What is the boiling point of Ferrugine?

The boiling point of Ferrugine is predicted to be 337.5±25.0 °C.

What is the predicted density of Ferrugine?

The predicted density of Ferrugine is 1.086±0.06 g/cm3.

What is the predicted pka value of Ferrugine?

The predicted pka value of Ferrugine is 10.38±0.40.

Where has Ferrugine recently been discovered?

Ferrugine has recently been discovered in the basic extract of Darlingia ferruginea.

In which part of Darlingia ferruginea does Ferrugine occur?

Ferrugine occurs in the leaves and stems of Darlingia ferruginea.

How was the structure of Ferrugine determined?

The structure of Ferrugine was determined from chemical analysis and spectroscopic investigation.

What type of alkaloid is Ferrugine?

Ferrugine is a tropane alkaloid.

※ Please kindly note that our products are for research use only.