Ferruginine

Catalog Number	ACM73069633
CAS Number	73069-63-3
Synonyms	1-[(1S,5R)-8-Methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl]ethanone
Molecular Weight	165.23
InChI	InChI=1S/C10H15NO/c1-7(12)9-5-3-8-4-6-10(9)11(8)2/h5,8,10H,3-4,6H2,1-2H3
InChI Key	KQIRSQYBYQBMIG-UHFFFAOYSA-N
Purity	95%+
Complexity	244
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	165.115364102
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	165.115364102
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	20.3 Ų

Custom Q&A

What is the product name of ferruginine?

The product name of ferruginine is ferruginine.

What are some synonyms for ferruginine?

Some synonyms for ferruginine are 1-[(1S,5R)-8-Methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl]ethanone and (1R,5S)-2-Acetyl-8-methyl-8-azabicyclo[3.2.1]oct-2-ene.

What is the CAS number for ferruginine?

The CAS number for ferruginine is 73069-63-3.

What is the molecular formula of ferruginine?

The molecular formula of ferruginine is C10H15NO.

What is the molecular weight of ferruginine?

The molecular weight of ferruginine is 165.23 g/mol.

What is the predicted boiling point of ferruginine?

The predicted boiling point of ferruginine is 266.8±28.0 °C.

What is the predicted density of ferruginine?

The predicted density of ferruginine is 1.055±0.06 g/cm3.

What is the predicted pka value of ferruginine?

The predicted pka value of ferruginine is 8.05±0.40.

※ Please kindly note that our products are for research use only.