Ferruginine

Ferruginine

Inquiry
Catalog Number ACM73069633
CAS Number 73069-63-3
Structure
Synonyms 1-[(1S,5R)-8-Methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl]ethanone
Molecular Weight 165.23
InChI InChI=1S/C10H15NO/c1-7(12)9-5-3-8-4-6-10(9)11(8)2/h5,8,10H,3-4,6H2,1-2H3
InChI Key KQIRSQYBYQBMIG-UHFFFAOYSA-N
Purity 95%+
Complexity 244
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 165.115364102
Heavy Atom Count 12
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 0
Monoisotopic Mass 165.115364102
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 20.3 Ų
Custom Q&A

What is the product name of ferruginine?

The product name of ferruginine is ferruginine.

What are some synonyms for ferruginine?

Some synonyms for ferruginine are 1-[(1S,5R)-8-Methyl-8-azabicyclo[3.2.1]oct-2-en-2-yl]ethanone and (1R,5S)-2-Acetyl-8-methyl-8-azabicyclo[3.2.1]oct-2-ene.

What is the CAS number for ferruginine?

The CAS number for ferruginine is 73069-63-3.

What is the molecular formula of ferruginine?

The molecular formula of ferruginine is C10H15NO.

What is the molecular weight of ferruginine?

The molecular weight of ferruginine is 165.23 g/mol.

What is the predicted boiling point of ferruginine?

The predicted boiling point of ferruginine is 266.8±28.0 °C.

What is the predicted density of ferruginine?

The predicted density of ferruginine is 1.055±0.06 g/cm3.

What is the predicted pka value of ferruginine?

The predicted pka value of ferruginine is 8.05±0.40.

※ Please kindly note that our products are for research use only.