Flavinantine

Catalog Number	ACM19777823
CAS Number	19777-82-3
Synonyms	5,6,8,14-Tetradehydro-3-hydroxy-2,6-dimethoxy-17-methylmorphinan-7-one
Molecular Weight	327.4
InChI	InChI=1S/C19H21NO4/c1-20-5-4-19-10-18(24-3)16(22)9-13(19)14(20)6-11-7-17(23-2)15(21)8-12(11)19/h7-10,14,21H,4-6H2,1-3H3/t14-,19-/m1/s1
InChI Key	GSNZKNRMDZYEAI-AUUYWEPGSA-N
Purity	95%+
Complexity	613
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	327.14705815
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1CC[C@]23C=C(C(=O)C=C2[C@H]1CC4=CC(=C(C=C34)O)OC)OC
Monoisotopic Mass	327.14705815
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	59 Ų

Custom Q&A

What is the chemical formula of Flavinantine?

The chemical formula of Flavinantine is C19H21NO4.

What is the molecular weight of Flavinantine?

The molecular weight of Flavinantine is 327.37 g/mol.

What is the CAS number for Flavinantine?

The CAS number for Flavinantine is 19777-82-3.

What is the melting point of Flavinantine?

The melting point of Flavinantine is 130.2 °C.

What is the predicted boiling point of Flavinantine?

The predicted boiling point of Flavinantine is 545.6±50.0 °C.

What is the predicted density of Flavinantine?

The predicted density of Flavinantine is 1.33±0.1 g/cm3.

What is the predicted pka of Flavinantine?

The predicted pka of Flavinantine is 9.65±0.40.

What are the synonyms for Flavinantine?

The synonyms for Flavinantine are 5,6,8,14-Tetradehydro-3-hydroxy-2,6-dimethoxy-17-methylmorphinan-7-one and Morphinan-7-one, 5,6,8,14-tetradehydro-3-hydroxy-2,6-dimethoxy-17-methyl-.

Why is Flavinantine used?

Flavinantine is used as a chemical intermediate in various processes.

How is Flavinantine typically prepared?

Flavinantine can be prepared through specific chemical synthesis methods that involve several steps.

※ Please kindly note that our products are for research use only.