Floribundine

Catalog Number	ACM33770273
CAS Number	33770-27-3
Synonyms	(±)-2-Hydroxy-1-methoxyaporphine
Molecular Weight	281.3
InChI	InChI=1S/C18H19NO2/c1-19-8-7-12-10-15(20)18(21-2)17-13-6-4-3-5-11(13)9-14(19)16(12)17/h3-6,10,14,20H,7-9H2,1-2H3
InChI Key	AKXOIHNFHOEPHN-UHFFFAOYSA-N
Purity	95%+
Complexity	387
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	281.141578849
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	281.141578849
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	32.7 Ų

Custom Q&A

What is the chemical name of ORTHO-NORNUCIFERINE?

The chemical name of ORTHO-NORNUCIFERINE is (6aR)-5,6,6a,7-Tetrahydro-1-methoxy-6-methyl-4H-dibenzo[de,g]quinolin-2-ol.

What are some synonyms for ORTHO-NORNUCIFERINE?

Some synonyms for ORTHO-NORNUCIFERINE are O-demethyl nuciferine, floribundine, and O-Nornuciferine.

What is the CAS number for ORTHO-NORNUCIFERINE?

The CAS number for ORTHO-NORNUCIFERINE is 3153-55-7.

What is the molecular formula of ORTHO-NORNUCIFERINE?

The molecular formula of ORTHO-NORNUCIFERINE is C18H19NO2.

What is the molecular weight of ORTHO-NORNUCIFERINE?

The molecular weight of ORTHO-NORNUCIFERINE is 281.35.

At what temperature does ORTHO-NORNUCIFERINE melt?

ORTHO-NORNUCIFERINE melts at 195-197℃ in ethyl acetate.

What is the predicted boiling point of ORTHO-NORNUCIFERINE?

The predicted boiling point of ORTHO-NORNUCIFERINE is 451.4±45.0 °C.

What is the predicted density of ORTHO-NORNUCIFERINE?

The predicted density of ORTHO-NORNUCIFERINE is 1.216±0.06 g/cm3.

What is the predicted pka value of ORTHO-NORNUCIFERINE?

The predicted pka value of ORTHO-NORNUCIFERINE is 10.12±0.20.

What type of channels does ORTHO-NORNUCIFERINE inhibit?

ORTHO-NORNUCIFERINE inhibits potassium channels.

※ Please kindly note that our products are for research use only.