Floridanine

Catalog Number	ACM16958319
CAS Number	16958-31-9
Synonyms	12-(Acetyloxy)-15,20-dihydro-15,20-dihydroxy-4-methyl-4,8-secosenecionan-8,11,16-trione
Molecular Weight	441.5
InChI	InChI=1S/C21H31NO9/c1-12-10-21(28,13(2)23)19(27)30-16-7-9-22(5)8-6-15(17(16)25)11-29-18(26)20(12,4)31-14(3)24/h6,12-13,16,23,28H,7-11H2,1-5H3/b15-6-/t12-,13,16-,20-,21+/m1/s1
InChI Key	MPJBVZKNLCGQHF-BEZRETPRSA-N
Purity	95%+
Complexity	779
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	441.19988157
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	10
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@@H]1C[C@@](C(=O)O[C@@H]2CCN(C/C=C(\C2=O)/COC(=O)[C@]1(C)OC(=O)C)C)(C(C)O)O
Monoisotopic Mass	441.19988157
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	140 Ų

Custom Q&A

What is the chemical name of the compound Floridanine?

The chemical name of the compound Floridanine is 12-(Acetyloxy)-15,20-dihydro-15,20-dihydroxy-4-methyl-4,8-secosenecionan-8,11,16-trione.

What are some synonyms for Floridanine?

Some synonyms for Floridanine are 12-Acetoxy-15,20-dihydro-15,20-dihydroxy-4-methyl-4,8-secosenecionan-8,11,16-trione and Floridanine[neutral].

What is the CAS number of Floridanine?

The CAS number of Floridanine is 16958-31-9.

What is the molecular formula of Floridanine?

The molecular formula of Floridanine is C21H31NO9.

What is the molecular weight of Floridanine?

The molecular weight of Floridanine is 441.47.

What is the boiling point of Floridanine?

The boiling point of Floridanine is predicted to be 636.2±55.0 °C.

What is the density of Floridanine?

The density of Floridanine is predicted to be 1.30±0.1 g/cm3.

What is the pKa value of Floridanine?

The pKa value of Floridanine is predicted to be 12.16±0.60.

How is Floridanine obtained in nature?

Floridanine is obtained from the roots of Senecio orthonnae, as this plant yields this pyrrolizidine alkaloid.

What chemical properties characterize Floridanine?

Floridanine is characterized by its molecular structure containing acetyloxy and hydroxy functional groups, as well as a secosenecionan ring system.

※ Please kindly note that our products are for research use only.