Florosenine

Catalog Number	ACM16958308
CAS Number	16958-30-8
Synonyms	(20S)-15α,20-Epoxy-15,20-dihydro-4-methyl-8,11,16-trioxo-4,8-secosenecionan-12-ol 12-acetate
Molecular Weight	423.5
InChI	InChI=1S/C21H29NO8/c1-12-10-21(13(2)29-21)19(26)28-16-7-9-22(5)8-6-15(17(16)24)11-27-18(25)20(12,4)30-14(3)23/h6,12-13,16H,7-11H2,1-5H3/b15-6-/t12-,13+,16-,20-,21/m1/s1
InChI Key	RNNVXCSFOWGBQP-XHLNSLBNSA-N
Purity	95%+
Complexity	792
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	423.18931688
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	0
Isomeric SMILES	C[C@@H]1CC2([C@@H](O2)C)C(=O)O[C@@H]3CCN(C/C=C(\C3=O)/COC(=O)[C@]1(C)OC(=O)C)C
Monoisotopic Mass	423.18931688
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	112 Ų

Custom Q&A

What is the chemical name of FLOROSENINE?

The chemical name of FLOROSENINE is (20S)-15α,20-Epoxy-15,20-dihydro-4-methyl-8,11,16-trioxo-4,8-secosenecionan-12-ol 12-acetate.

What are some synonyms for FLOROSENINE?

Some synonyms for FLOROSENINE are FLOROSENINE, Florosenine[neutral], and Spiro[2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-ene-4,2'-oxirane]-3,8,17-trione, 7-(acetyloxy)-3',6,7,14-tetramethyl-, (1R,2'S,3'S,6R,7R)-.

What is the CAS number for FLOROSENINE?

The CAS number for FLOROSENINE is 16958-30-8.

What is the molecular formula of FLOROSENINE?

The molecular formula of FLOROSENINE is C21H29NO8.

What is the molar mass of FLOROSENINE?

The molar mass of FLOROSENINE is 423.46 g/mol.

What is the predicted boiling point of FLOROSENINE?

The predicted boiling point of FLOROSENINE is 626.3±55.0 °C.

What is the predicted density of FLOROSENINE?

The predicted density of FLOROSENINE is 1.27±0.1 g/cm3.

What is the predicted pKa value of FLOROSENINE?

The predicted pKa value of FLOROSENINE is 6.73±0.70.

What is the RIDADR code for FLOROSENINE?

The RIDADR code for FLOROSENINE is 1544.

What is the hazard class and packing group for FLOROSENINE?

The hazard class for FLOROSENINE is 6.1(b) and the packing group is III.

※ Please kindly note that our products are for research use only.