Fuligorubin A

Fuligorubin A

Inquiry
Catalog Number ACM108343551
CAS Number 108343-55-1
Structure
Molecular Weight 357.4
InChI InChI=1S/C20H23NO5/c1-3-4-5-6-7-8-9-10-11-12-16(22)18-19(25)15(13-14-17(23)24)21(2)20(18)26/h3-12,15,22H,13-14H2,1-2H3,(H,23,24)
InChI Key VRWPPQTYMAFCLL-UHFFFAOYSA-N
Purity 95%+
Complexity 723
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 357.15762283
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 2
Monoisotopic Mass 357.15762283
PhysicalState Powder
Rotatable Bond Count 8
Topological Polar Surface Area 94.9 Ų
Custom Q&A

What is the chemical structure of Fuligorubin A?

The chemical structure of Fuligorubin A is 1H-Pyrrole-2-propanoic acid, 2,5-dihydro-3-hydroxy-1-methyl-5-oxo-4-[(2E,4E,6E,8E,10E)-1-oxo-2,4,6,8,10-dodecapentaen-1-yl]-, (2R)-.

What is the CAS number of Fuligorubin A?

The CAS number of Fuligorubin A is 108343-55-1.

What is the molecular formula of Fuligorubin A?

The molecular formula of Fuligorubin A is C20H23NO5.

What is the molecular weight of Fuligorubin A?

The molecular weight of Fuligorubin A is 357.4.

What is the melting point of Fuligorubin A?

The melting point of Fuligorubin A is greater than 150°C.

What is the predicted boiling point of Fuligorubin A?

The predicted boiling point of Fuligorubin A is 626.0±55.0 °C.

What is the predicted density of Fuligorubin A?

The predicted density of Fuligorubin A is 1.208±0.06 g/cm3.

What is the predicted pka value of Fuligorubin A?

The predicted pka value of Fuligorubin A is 4.50±1.00.

What are some synonyms of Fuligorubin A?

Some synonyms of Fuligorubin A are 1H-Pyrrole-2-propanoic acid, 2,5-dihydro-3-hydroxy-1-methyl-5-oxo-4-[(2E,4E,6E,8E,10E)-1-oxo-2,4,6,8,10-dodecapentaen-1-yl]-, (2R)-.

※ Please kindly note that our products are for research use only.