Fumitremorgin B

Catalog Number	ACM12626174
CAS Number	12626-17-4
Structure
Synonyms	(5aR)-1,2,3,5a,6,11,12,14aβ-Octahydro-5aβ,6β-dihydroxy-9-methoxy-11-(3-methyl-2-butenyl)-12α-(2-methyl-1-propenyl)-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione
Molecular Weight	479.6
InChI	InChI=1S/C27H33N3O5/c1-15(2)10-12-28-20-14-17(35-5)8-9-18(20)22-23(28)21(13-16(3)4)30-25(32)19-7-6-11-29(19)26(33)27(30,34)24(22)31/h8-10,13-14,19,21,24,31,34H,6-7,11-12H2,1-5H3/t19-,21-,24-,27+/m0/s1
InChI Key	WEIYXEFMCIRZHC-MWGWWEMPSA-N
Melting Point	205-207 °C
Purity	95%+
Complexity	941
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	479.24202116
Heavy Atom Count	35
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC(=CCN1C2=C(C=CC(=C2)OC)C3=C1[C@@H](N4C(=O)[C@@H]5CCCN5C(=O)[C@@]4([C@H]3O)O)C=C(C)C)C
Monoisotopic Mass	479.24202116
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	95.2 Ų

Custom Q&A

What is the chemical formula for fumitremorgin B?

The chemical formula for fumitremorgin B is C27H33N3O5.

What is the molecular weight of fumitremorgin B?

The molecular weight of fumitremorgin B is 479.57.

What is the melting point of fumitremorgin B?

The melting point of fumitremorgin B is 205-207°C.

In what form does fumitremorgin B exist?

Fumitremorgin B exists in the form of a solid.

What is the storage temperature recommended for fumitremorgin B?

Fumitremorgin B should be stored at -20°C.

What is the solubility of fumitremorgin B in DMSO?

Fumitremorgin B is soluble in DMSO.

What is the main source of production of fumitremorgin B?

Fumitremorgin B is elaborated by Aspergillus jurnigatus.

How is the structure of fumitremorgin B determined?

The structure of fumitremorgin B has been determined from X-ray crystallography.

What is the absolute configuration of fumitremorgin B based on?

The absolute configuration of fumitremorgin B is based on the L(-)-proline formed by acid hydrolysis of the alkaloid.

In what way is fumitremorgin B produced by fungi?

Fumitremorgin B is produced by several fungi via a tryptophan-proline diketopiperazine intermediate.

※ Please kindly note that our products are for research use only.