Gardneramine

Catalog Number	ACM34274914
CAS Number	34274-91-4
Structure
Synonyms	1,2-Didehydro-2-deoxo-17-deoxy-2,17-epoxygardneramine oxindole
Molecular Weight	412.5
Molecular Formula	C23H28N2O5
InChI	InChI=1S/C23H28N2O5/c1-26-6-5-12-10-25-15-9-23-18(25)7-13(12)14(15)11-30-22(23)24-20-16(27-2)8-17(28-3)21(29-4)19(20)23/h5,8,13-15,18H,6-7,9-11H2,1-4H3/b12-5+/t13-,14+,15+,18,23/m1/s1
InChI Key	RIMDDIPKIZTBHU-KPDHXFAYSA-N
Purity	95%+
Density	5mg 10mg 20 mg
Complexity	771
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	412.199822
Heavy Atom Count	30
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	0
Isomeric SMILES	COC/C=C/1\CN2[C@H]3CC45C2C[C@H]1[C@@H]3COC4=NC6=C5C(=C(C=C6OC)OC)OC
Monoisotopic Mass	412.199822
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	61.8 Ų

Custom Q&A

What is the chemical formula of gardneramine?

The chemical formula of gardneramine is C23H28N2O5.

What is the molecular weight of gardneramine?

The molecular weight of gardneramine is 412.483.

What is the CAS number for gardneramine?

The CAS number for gardneramine is 34274-91-4.

What is the melting point of gardneramine?

The melting point of gardneramine is 133-134 °C.

What is the predicted boiling point of gardneramine?

The predicted boiling point of gardneramine is 570.3±60.0 °C.

What is the predicted density of gardneramine?

The predicted density of gardneramine is 1.46±0.1 g/cm3.

What is the pka value of gardneramine?

The pka value of gardneramine is 8.59±0.20.

In which plant is gardneramine naturally found?

Gardneramine is a natural product found in Gardneria ovata.

What are some synonyms for gardneramine?

Some synonyms for gardneramine are 1,2-Didehydo-2-deoxo-17-deoxy-2,17-epoxgardneramine oxindole and 1,2-Didehydro-2-deoxo-17-deoxy-2,17-epoxygardneramine oxindole.

What is the molecular file for gardneramine?

The molecular file for gardneramine is 34274-91-4.mol.

※ Please kindly note that our products are for research use only.