Gelsempervine A

Catalog Number	ACM865187173
CAS Number	865187-17-3
Synonyms	16-epi-Nb-Methylvoacarpine
Molecular Weight	382.5
InChI	InChI=1S/C22H26N2O4/c1-4-13-11-24(2)19-9-15-14-7-5-6-8-17(14)23-20(15)18(26)10-16(13)22(19,12-25)21(27)28-3/h4-8,16,19,23,25H,9-12H2,1-3H3/b13-4-/t16-,19-,22+/m0/s1
InChI Key	CZRUSFCSECMUDS-VQHRILDESA-N
Purity	95%+
Complexity	677
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	382.18925731
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/CN([C@H]2CC3=C(C(=O)C[C@@H]1[C@@]2(CO)C(=O)OC)NC4=CC=CC=C34)C
Monoisotopic Mass	382.18925731
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	82.6 Ų

Custom Q&A

What is the chemical name of the compound also known as Gelsempervine A?

The chemical name is 16-epi-Nb-Methylvoacarpine.

What are some synonyms for Gelsempervine A?

Some synonyms include (19E)-Gelsempervine C and Gelsempervine A.

What is the CAS number for Gelsempervine A?

The CAS number is 865187-17-3.

What is the molecular formula of Gelsempervine A?

The molecular formula is C22H26N2O4.

What is the molecular weight of Gelsempervine A?

The molecular weight is 382.45.

In what forms is 16-epi-Nb-Methylvoacarpine soluble?

It is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the physical form of 16-epi-Nb-Methylvoacarpine?

It is in the form of powder.

Where does Gelsempervine A come from?

Gelsempervine A is a natural product from Gelsemium elegans.

What are the potential uses of Gelsempervine A?

The compound might have various applications in research and pharmaceuticals due to its properties.

Can Gelsempervine A be used in medical treatments?

It is possible that Gelsempervine A could be used in medical treatments, but further research would be needed to determine its efficacy and safety.

※ Please kindly note that our products are for research use only.