Gentianine

Gentianine

Inquiry
Catalog Number ACM439894
CAS Number 439-89-4
Structure
Synonyms 5-Ethenyl-3,4-dihydro-1H-pyrano[3,4-c]pyridin-1-one
Molecular Weight 175.18
InChI InChI=1S/C10H9NO2/c1-2-7-5-11-6-9-8(7)3-4-13-10(9)12/h2,5-6H,1,3-4H2
InChI Key DFNZYFAJQPLJFI-UHFFFAOYSA-N
Melting Point 84-86 °C
Purity 95%+
Complexity 227
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 175.06332853
Heavy Atom Count 13
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 0
Monoisotopic Mass 175.06332853
PhysicalState Powder
Rotatable Bond Count 1
Topological Polar Surface Area 39.2 Ų
Custom Q&A

What is another name for ERYTHRICINE?

GENTIANINE is another name for ERYTHRICINE.

What is the molecular formula of ERYTHRICINE?

The molecular formula of ERYTHRICINE is C10H9NO2.

What is the molecular weight of ERYTHRICINE?

The molecular weight of ERYTHRICINE is 175.18.

What is the main usage of Gentianine?

Gentianine is used as an anti-inflammatory, reducing the production of pro-inflammatory cytokines.

How does Gentianine act as an anti-inflammatory?

Gentianine reduces the production of pro-inflammatory cytokines to act as an anti-inflammatory agent.

What type of compound is ERYTHRICINE?

ERYTHRICINE is classified as a compound with anti-inflammatory properties.

How does ERYTHRICINE affect cytokine production?

ERYTHRICINE reduces the production of pro-inflammatory cytokines.

What is the function of ERYTHRICINE in the body?

ERYTHRICINE functions as an anti-inflammatory agent in the body.

What is the chemical structure of ERYTHRICINE?

The chemical structure of ERYTHRICINE is characterized by the specific arrangement of its carbon, hydrogen, nitrogen, and oxygen atoms in the molecule.

What is the biological activity of ERYTHRICINE?

ERYTHRICINE exhibits biological activity as an anti-inflammatory agent by modulating cytokine production.

※ Please kindly note that our products are for research use only.