Gentioflavine

Catalog Number	ACM18058509
CAS Number	18058-50-9
Structure
Synonyms	3,4,6,7-Tetrahydro-6-methyl-1-oxo-1H-pyrano[3,4-c]pyridine-5-carbaldehyde
Molecular Weight	193.2
InChI	InChI=1S/C10H11NO3/c1-6-9(5-12)7-2-3-14-10(13)8(7)4-11-6/h4-6,11H,2-3H2,1H3
InChI Key	GLNRAZLQBMAROT-UHFFFAOYSA-N
Purity	95%+
Complexity	354
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	193.07389321
Heavy Atom Count	14
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	1
Monoisotopic Mass	193.07389321
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	55.4 Ų

Custom Q&A

What is the synonym for Gentioflavine?

The synonym for Gentioflavine is Gentioflavin.

What is the chemical formula for Gentioflavine?

The chemical formula for Gentioflavine is C10H11NO3.

What is the molecular weight of Gentioflavine?

The molecular weight of Gentioflavine is 193.2.

What is the melting point of Gentioflavine?

The melting point of Gentioflavine is 218-220 °C (decomp).

What is the boiling point of Gentioflavine?

The boiling point of Gentioflavine is 441.0±45.0 °C (Predicted).

What is the density of Gentioflavine?

The density of Gentioflavine is 1.27±0.1 g/cm3 (Predicted).

What is the pka value of Gentioflavine?

The pka value of Gentioflavine is 2.31±0.60 (Predicted).

How is Gentioflavine defined in ChEBI?

Gentioflavine is defined as a delta-lactone in ChEBI.

What is the CAS number for Gentioflavine?

The CAS number for Gentioflavine is 18058-50-9.

What is the structure of Gentioflavine?

The structure of Gentioflavine is 3,4,6,7-tetrahydro-6-methyl-1-oxo-1H-pyrano[3,4-c]pyridine-5-carbaldehyde.

※ Please kindly note that our products are for research use only.