Ginkgolic acid

Catalog Number	ACM22910607-2
CAS Number	22910-60-7
Structure
Synonyms	Ginkgolic acid I
IUPAC Name	2-Hydroxy-6-[(Z)-pentadec-8-enyl]benzoic acid
Molecular Weight	346.5
Molecular Formula	C22H34O3
Canonical SMILES	CCCCCCC=CCCCCCCCC1=C(C(=CC=C1)O)C(=O)O
InChI	InChI=1S/C22H34O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(23)21(19)22(24)25/h7-8,15,17-18,23H,2-6,9-14,16H2,1H3,(H,24,25)/b8-7-
InChI Key	YXHVCZZLWZYHSA-FPLPWBNLSA-N
Purity	98%+(HPLC)
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	364
Exact Mass	346.25079494
Heavy Atom Count	25
Isomeric SMILES	CCCCCC/C=C\CCCCCCCC1=C(C(=CC=C1)O)C(=O)O
Monoisotopic Mass	346.25079494
Topological Polar Surface Area	57.5Ų

Custom Q&A

What is the chemical formula of Ginkgolic acid?

The chemical formula of Ginkgolic acid is C22H34O3.

What is the melting point of Ginkgolic acid?

The melting point of Ginkgolic acid is 45-48°C.

What is the solubility of Ginkgolic acid in chloroform?

Ginkgolic acid is slightly soluble in chloroform.

What is the InChIKey of Ginkgolic acid?

The InChIKey of Ginkgolic acid is YXHVCZZLWZYHSA-FPLPWBNLSA-N.

What are the hazard codes associated with Ginkgolic acid?

The hazard code associated with Ginkgolic acid is Xi.

What is the description of Ginkgolic acid?

Ginkgolic acid is slightly toxic and an allergen, with potential therapeutic applications such as ameliorating dementia.

How is Ginkgolic acid used in the quantitative determination of alkylphenols?

Ginkgolic acid C15:1 may be used as a reference standard in the quantitative determination of alkylphenols like ginkgolic acids using HPLC-MS.

What is the biochem/physiol action of Ginkgolic acid?

Ginkgolic acid is cell permeable.

What is the definition of Ginkgolic acid according to ChEBI?

Ginkgolic acid is a hydroxybenzoic acid derived from a salicylic acid.

How does Ginkgolic acid inhibit SUMOylation?

Ginkgolic acid C15:1 inhibits SUMOylation by directly binding the SUMO-activating enzyme E1, blocking the formation of the E1-SUMO intermediate.

※ Please kindly note that our products are for research use only.