Glabredelphinine

Catalog Number	ACM132160373
CAS Number	132160-37-3
Synonyms	Aconitane-1,6,7,8,14-pentol, 2,3-didehydro-20-ethyl-16-methoxy-4-methyl-, (1α,6β,14α,16β)- (9CI)
Molecular Weight	407.5
InChI	InChI=1S/C22H33NO6/c1-4-23-9-19(2)6-5-13(24)21-11-7-10-12(29-3)8-20(27,14(11)15(10)25)22(28,18(21)23)17(26)16(19)21/h5-6,10-18,24-28H,4,7-9H2,1-3H3/t10-,11?,12+,13+,14-,15+,16-,17+,18,19+,20-,21,22/m1/s1
InChI Key	DTGBDZOZFYXFTM-MOHLLOFASA-N
Purity	95%+
Complexity	791
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	9
Exact Mass	407.23078777
Heavy Atom Count	29
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	5
Isomeric SMILES	CCN1C[C@@]2(C=C[C@@H](C34[C@@H]2[C@@H](C(C31)([C@]5(C[C@@H]([C@H]6CC4[C@@H]5[C@H]6O)OC)O)O)O)O)C
Monoisotopic Mass	407.23078777
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	114 Ų

Custom Q&A

What is the chemical formula for glabredelphinine?

The chemical formula for glabredelphinine is C22H33NO6.

What is the molecular weight of glabredelphinine?

The molecular weight of glabredelphinine is 407.51.

What is the CAS number for glabredelphinine?

The CAS number for glabredelphinine is 132160-37-3.

What are some synonyms for glabredelphinine?

Some synonyms for glabredelphinine include Aconitane-1,6,7,8,14-pentol, 2,3-didehydro-20-ethyl-16-methoxy-4-methyl-, (1α,6β,14α,16β)-.

What is the predicted boiling point of glabredelphinine?

The predicted boiling point of glabredelphinine is 603.1±55.0 °C.

What is the predicted density of glabredelphinine?

The predicted density of glabredelphinine is 1.47±0.1 g/cm3.

What is the predicted pka value of glabredelphinine?

The predicted pka value of glabredelphinine is 12±0.70.

Is glabredelphinine a naturally occurring compound?

Yes, glabredelphinine is a naturally occurring compound.

What type of compound is glabredelphinine?

Glabredelphinine belongs to the class of organic compounds known as diterpenoid alkaloids.

What are some potential applications of glabredelphinine?

Glabredelphinine may have potential applications in the fields of medicine and pharmacology due to its chemical properties.

※ Please kindly note that our products are for research use only.