Glaucin B

Catalog Number	ACM115458736-1
CAS Number	115458-73-6
IUPAC Name	[(1R,2R,7S,10R,11S,13R,14R,16S,19S,20S)-19-(Furan-3-yl)-9,9,13,20-tetramethyl-5,12,17-trioxo-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosan-11-yl] acetate
Molecular Weight	528.5
Molecular Formula	C28H32O10
Canonical SMILES	CC(=O)OC1C2C(OC3C2(COC(=O)C3)C4CCC5(C(OC(=O)C6C5(C4(C1=O)C)O6)C7=COC=C7)C)(C)C
InChI	InChI=1S/C28H32O10/c1-13(29)35-18-19-24(2,3)37-16-10-17(30)34-12-27(16,19)15-6-8-25(4)21(14-7-9-33-11-14)36-23(32)22-28(25,38-22)26(15,5)20(18)31/h7,9,11,15-16,18-19,21-22H,6,8,10,12H2,1-5H3/t15-,16-,18-,19+,21-,22+,25-,26-,27-,28+/m0/s1
InChI Key	IHOHGVDNDQTZGL-MDOWBRFOSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	1150
Exact Mass	528.19954721
Heavy Atom Count	38
Isomeric SMILES	CC(=O)O[C@H]1[C@H]2[C@@]3(COC(=O)C[C@@H]3OC2(C)C)[C@H]4CC[C@]5([C@@H](OC(=O)[C@@H]6[C@@]5([C@@]4(C1=O)C)O6)C7=COC=C7)C
Monoisotopic Mass	528.19954721
Topological Polar Surface Area	131Ų

Custom Q&A

What is the usage of Glaucin B?

Glaucin B shows potent and selective in vitro cytotoxicities among several human solid tumor cell lines.

What are some synonyms for Glaucin B?

Some synonyms for Glaucin B are 11H,13H-Oxireno[d]pyrano[4',3':3,3a]isobenzofuro[5,4-f][2]benzopyran-4,6,13(2H,5aH)-trione,3-(acetyloxy)-8-(3-furanyl)decahydro-2,2,4a,8a-tetramethyl-, and 6β-Acetoxy-5-epilimonin.

What is the CAS number for Glaucin B?

The CAS number for Glaucin B is 115458-73-6.

What is the molecular weight of Glaucin B?

The molecular weight of Glaucin B is 528.55.

What is the melting point of Glaucin B and in what solvent was it measured?

The melting point of Glaucin B is 256-258 °C and it was measured in methanol.

In which solvents is Glaucin B soluble?

Glaucin B is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What are the chemical properties of Glaucin B?

The chemical properties of Glaucin B include a predicted boiling point of 702.2±60.0 °C, a predicted density of 1.41±0.1 g/cm3, and it is in powder form.

What are the potential applications of Glaucin B based on its chemical properties?

Glaucin B could potentially be used in the development of drugs for treating solid tumors.

In which areas of research could Glaucin B be further studied?

Glaucin B could be further studied in the fields of oncology and pharmaceutical research for its cytotoxic effects on solid tumor cell lines.

※ Please kindly note that our products are for research use only.