Glycoperine

Catalog Number	ACM55740459
CAS Number	55740-45-9
Synonyms	[4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl]6-deoxy-α-L-mannopyranoside
Molecular Weight	391.4
InChI	InChI=1S/C19H21NO8/c1-8-13(21)14(22)15(23)19(27-8)28-11-5-4-9-12(17(11)25-3)20-18-10(6-7-26-18)16(9)24-2/h4-8,13-15,19,21-23H,1-3H3/t8-,13-,14+,15+,19-/m0/s1
InChI Key	KJOKSAQCWDHTOL-QTOAMZBASA-N
Complexity	538
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	391.12671663
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	9
Hydrogen Bond Donor Count	3
Isomeric SMILES	C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=C(C3=C(C=C2)C(=C4C=COC4=N3)OC)OC)O)O)O
Monoisotopic Mass	391.12671663
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	124 Ų

Custom Q&A

What is the chemical name of Glycoperine?

[4,8-Dimethoxyfuro[2,3-b]quinolin-7-yl]6-deoxy-α-L-mannopyranoside

What are some synonyms for Glycoperine?

Glycoperine and α-L-Mannopyranoside, 4,8-dimethoxyfuro[2,3-b]quinolin-7-yl 6-deoxy-

What is the CAS number for Glycoperine?

55740-45-9

What is the molecular formula of Glycoperine?

C19H21NO8

What is the molecular weight of Glycoperine?

391.37

What type of compound is Glycoperine?

Glycosidic alkaloid of the furanoquinoline type

Where does Glycoperine occur naturally?

In the extract from Haplophyllum perforatum

How has the structure of Glycoperine been established?

From a study of the infrared, ultraviolet, NMR, and mass spectra

What is the chemical class of Glycoperine according to ChEBI?

Organonitrogen heterocyclic compound, organic heterotricyclic compound, and oxacycle

※ Please kindly note that our products are for research use only.