Glycosolone

Glycosolone

Inquiry
Catalog Number ACM67879816
CAS Number 67879-81-6
Structure
Synonyms 8-Hydroxy-4-methoxy-1-methyl-3-(3-methyl-2-buten-1-yl)-2(1H)-quinolinone
Molecular Weight 273.33
InChI InChI=1S/C16H19NO3/c1-10(2)8-9-12-15(20-4)11-6-5-7-13(18)14(11)17(3)16(12)19/h5-8,18H,9H2,1-4H3
InChI Key KBMGLVFFJUCSBR-UHFFFAOYSA-N
Purity 95%+
Complexity 449
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 273.13649347
Heavy Atom Count 20
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 1
Monoisotopic Mass 273.13649347
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 49.8 Ų
Custom Q&A

What is the chemical name of Glycosolone?

The chemical name of Glycosolone is 8-Hydroxy-4-methoxy-1-methyl-3-(3-methyl-2-buten-1-yl)-2(1H)-quinolinone.

What are the synonyms of Glycosolone?

The synonyms of Glycosolone include Glycosolone and 2(1H)-Quinolinone, 8-hydroxy-4-methoxy-1-methyl-3-(3-methyl-2-buten-1-yl)-.

What is the CAS number of Glycosolone?

The CAS number of Glycosolone is 67879-81-6.

What is the molecular formula of Glycosolone?

The molecular formula of Glycosolone is C16H19NO3.

What is the molecular weight of Glycosolone?

The molecular weight of Glycosolone is 273.33.

How does Glycosolone occur naturally?

Glycosolone is a quinolone alkaloid that yields colorless crystals from MeOH and gives an ultraviolet spectrum in MeOH with absorption maxima at various wavelengths.

In what solvent does Glycosolone give an ultraviolet spectrum?

Glycosolone gives an ultraviolet spectrum in MeOH.

What are the absorption maxima wavelengths for Glycosolone in MeOH?

The absorption maxima wavelengths for Glycosolone in MeOH are 213, 237.2, 250.5, 258.5, 286, 295, 333, and 346 nm.

How is Glycosolone synthesized in the laboratory?

The synthesis of Glycosolone in the laboratory is not.

What are some potential uses of Glycosolone?

The potential uses of Glycosolone are not specified in the reference.

※ Please kindly note that our products are for research use only.